Phosphorus + Oxygen Compounds (P + O)
Browse all compounds containing Phosphorus + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
Total Compounds: 57,505
Showing 3,101 - 3,150 of 57,505
Page 63 of 1,151
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 95163 | C12H9Br2O2P | bis(3-bromophenyl)phosphinic acid | bis(3-bromophenyl)phosphinic acid | 375.98 |
| 95164 | C12H10ClO2P | (3-chlorophenyl)-phenyl-phosphinic acid | Phosphinic acid, (m-chlorophenyl)phenyl- | 252.63 |
| 95165 | C12H10NO4P | (3-nitrophenyl)-phenyl-phosphinic acid | (m-Nitrophenyl)phenylphosphinic acid | 263.19 |
| 95166 | C12H10NO4P | (4-nitrophenyl)-phenyl-phosphinic acid | Phosphinic acid, (p-nitrophenyl)phenyl- | 263.19 |
| 95212 | C7H13O4P | diethyl prop-2-ynyl phosphate | 17118-80-8 | 192.15 |
| 95481 | C11H19O8P | dimethyl 3-diethoxyphosphoryloxypent-2-enedioate | DTXSID401032389 | 310.24 |
| 95487 | C14H28O7P2 | 5-methyl-2-[(5-methyl-2-oxo-5-propyl-1,3,2lambda5-dioxaphosphinan-2-yl)oxy]-5-propyl-1,3,2lambda5-dioxaphosphinane 2-oxide | 742-72-3 | 370.32 |
| 95687 | C8H12NO5P | (5-hydroxy-4,6-dimethyl-3-pyridyl)methyl dihydrogen phosphate | 883-84-1 | 233.16 |
| 95691 | C4H12Cl2N3OP | 2-chloro-N-(2-chloroethyl)-N-diaminophosphoryl-ethanamine | Phosphoric triamide, N,N-bis(2-chloroethyl)- | 220.03 |
| 95710 | CH6ClN2OP | chloro(diaminophosphoryl)methane | p-(chloromethyl)phosphonic diamide | 128.50 |
| 95711 | C3H12N3OP | N-[bis(methylamino)phosphoryl]methanamine | Trimethylphosphoramide | 137.12 |
| 95712 | C5H14NO3P | N-diethoxyphosphorylmethanamine | diethyl methylamidophosphate | 167.14 |
| 95776 | C14H21N2O2PS | dimorpholino-phenyl-thioxo-lambda5-phosphane | Phosphine sulfide, dimorpholinophenyl- | 312.37 |
| 95892 | C14H20N4O4P2 | 1-[aziridin-1-yl-[4-[bis(aziridin-1-yl)phosphoryloxy]phenoxy]phosphoryl]aziridine | 1858-46-4 | 370.28 |
| 95923 | C4H10NO5P | methyl N-dimethoxyphosphorylcarbamate | 995-17-5 | 183.10 |
| 95924 | C6H14NO5P | isopropyl N-dimethoxyphosphorylcarbamate | Avenin | 211.15 |
| 95932 | C8H17N2O2P | 1-[aziridin-1-yl(butoxy)phosphoryl]aziridine | Bis(1-aziridinyl)phosphinic acid butyl ester | 204.21 |
| 95944 | C6H14ClO3PS | 1-chloro-2-diethoxyphosphorylsulfanyl-ethane | 6301-04-8 | 232.67 |
| 95951 | C12H21O4P | tris(2-methylallyl) phosphate | Phosphoric acid, tris(2-methylallyl)- | 260.27 |
| 95984 | C7H15Cl2N2OPS | N,N-bis(2-chloroethyl)-2-thioxo-1,3,2lambda5-oxazaphosphinan-2-amine | B 603 | 277.15 |
| 95985 | C9H21Cl2N2O3P | 3-[[bis(2-chloroethyl)amino-ethoxy-phosphoryl]amino]propan-1-ol | 78218-93-6 | 307.15 |
| 95986 | C8H17Cl2N2O2P | N-(2-chloroethyl)-N-(2-chloropropyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine | 78149-83-4 | 275.11 |
| 95987 | C10H22Cl3N2O3P | 3-[[bis(2-chloroethyl)amino-(3-chloropropoxy)phosphoryl]amino]propan-1-ol | B-701 | 355.6 |
| 95988 | C8H17Cl2N2O2P | N,N-bis(2-chloroethyl)-5-methyl-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine | 22089-26-5 | 275.11 |
| 96040 | C10H20N3OP | 1-[bis(aziridin-1-yl)phosphoryl]azepane | NSC-49424 | 229.26 |
| 96085 | C8H18N3OP | N-[bis(aziridin-1-yl)phosphoryl]butan-1-amine | P,P-Bis(1-aziridinyl)-N-butylphosphinic amide | 203.22 |
| 96105 | C7H16Cl2N3OP | N,N-bis(2-chloroethyl)-2-oxo-1,3,2lambda5-diazaphosphinan-2-amine | 20982-36-9 | 260.10 |
| 96179 | C18H39O4P | bis(3,5,5-trimethylhexyl) hydrogen phosphate | Bis(3,5,5-trimethylhexyl) hydrogen phosphate | 350.5 |
| 96193 | C12H17Cl3NO3P | 2-chloro-N-[2-chloroethoxy(phenoxy)phosphoryl]-N-(2-chloroethyl)ethanamine | 78218-72-1 | 360.6 |
| 96271 | C4H8Cl4NOP | 2-chloro-N-(2-chloroethyl)-N-dichlorophosphoryl-ethanamine | Bis(2-chloroethyl)phosphoramidic dichloride | 258.9 |
| 96287 | C18H33O6P | tris[(3-ethyloxetan-3-yl)methyl] phosphite | 39865-35-5 | 376.4 |
| 96314 | C6H6BrO3P | (3-bromophenyl)phosphonic acid | 6959-02-0 | 236.99 |
| 96320 | C8H18N3OPS | N-[bis(aziridin-1-yl)phosphinothioyl]-3-methoxy-propan-1-amine | Phosphinothioic amide, P,P-bis(1-aziridinyl)-N-(3-methoxypropyl)- | 235.29 |
| 96337 | C27H33O4P | tris(2-propylphenyl) phosphate | Tris(2-propylphenyl) phosphate | 452.5 |
| 96354 | C8H16Cl2N3OP | N-[bis(aziridin-1-yl)phosphoryl]-2-chloro-N-(2-chloroethyl)ethanamine | Phosphinic amide, bis(1-aziridinyl)-N-bis(2-chloroethyl)- | 272.11 |
| 96355 | C10H24Cl2N3O2P | amino-[bis(2-chloroethyl)amino]phosphinic acid;cyclohexanamine | NSC-69945 | 320.19 |
| 96356 | C4H11Cl2N2O2P | amino-[bis(2-chloroethyl)amino]phosphinic acid | Phosphoramide mustard | 221.02 |
| 96442 | C8H20O5P2 | diethylphosphoryl diethyl phosphate | 63886-53-3 | 258.19 |
| 96444 | C10H24O6P2 | [butyl(ethoxy)phosphoryl] diethyl phosphate | 63886-51-1 | 302.24 |
| 96445 | C8H20O4P2S2 | diethoxy-[ethoxy(ethyl)phosphinothioyl]oxy-thioxo-lambda5-phosphane | 63815-52-1 | 306.3 |
| 96459 | C18H36Cl3O4P | 1-[bis(2-ethylhexoxy)phosphoryl]-2,2,2-trichloro-ethanol | 63950-92-5 | 453.8 |
| 96535 | C12H17ClNO5P | 1-[4-chlorobutyl(ethoxy)phosphoryl]oxy-4-nitro-benzene | p-Nitrophenyl ethyl 4-chlorobutyl phosphonate | 321.69 |
| 96536 | C11H11O3P | 1-naphthylmethylphosphonic acid | 4730-77-2 | 222.18 |
| 96563 | C12H24N6O2P2 | 1,4-bis[bis(aziridin-1-yl)phosphoryl]piperazine | Dipin | 346.31 |
| 96630 | C4H2Cl3N4O3P | 4-chloro-N-dichlorophosphoryl-5-nitro-pyrimidin-2-amine | 6110-60-7 | 291.41 |
| 96632 | C8H15O4P | cyclopropyl(diethoxyphosphoryl)methanone | 1489-91-4 | 206.18 |
| 96659 | C18H14NO4P | 1-diphenylphosphoryloxy-4-nitro-benzene | 10259-20-8 | 339.3 |
| 96661 | C8H12N5OP | N-[bis(aziridin-1-yl)phosphoryl]pyrimidin-2-amine | Phosphemide | 225.19 |
| 96662 | C17H32N2O6P2 | 3,9-bis(azepan-1-yl)-2,4,8,10-tetraoxa-3lambda5,9lambda5-diphosphaspiro[5.5]undecane 3,9-dioxide | 19341-49-2 | 422.4 |
| 96668 | C4H10N3OP | 1-[amino(aziridin-1-yl)phosphoryl]aziridine | Phosphine oxide, bis(1-aziridinyl)anilino- | 147.12 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.