Phosphorus + Oxygen Compounds (P + O)
Browse all compounds containing Phosphorus + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 75816 | C12H27O4P | dodecyl dihydrogen phosphate | Dodecyl dihydrogen phosphate | 266.31 |
| 75852 | C10H8NaO4P | sodium 1-naphthyl hydrogen phosphate | sodium 1-naphthyl hydrogen phosphate | 246.13 |
| 75878 | C10H23O2PS3 | diisopropoxy-(isopropylsulfanylmethylsulfanyl)-thioxo-lambda5-phosphane | 2667-52-9 | 302.5 |
| 75917 | C6H15O3PS3 | 2-ethylsulfinylethylsulfanyl-dimethoxy-thioxo-lambda5-phosphane | Thiometon sulfoxide | 262.4 |
| 75939 | C10H12BrCl2O2PS | (4-bromo-2,5-dichloro-phenyl)methoxy-ethyl-methoxy-thioxo-lambda5-phosphane | CELA K-37 | 378.0 |
| 75940 | C10H12BrCl2O2PS | (4-bromo-2,5-dichloro-phenoxy)-isopropoxy-methyl-thioxo-lambda5-phosphane | 2720-18-5 | 378.0 |
| 75941 | C9H10BrCl2O2PS | (4-bromo-2,5-dichloro-phenoxy)-ethyl-methoxy-thioxo-lambda5-phosphane | 2720-19-6 | 364.02 |
| 75956 | C8H19O4P | butyl diethyl phosphate | Phosphoric acid, butyl diethyl ester | 210.21 |
| 75983 | C36H27O3P | tris(2-phenylphenyl) phosphite | 2752-19-4 | 538.6 |
| 75985 | C14H31O2P | tetradecylphosphinic acid | tetradecylphosphinic acid | 262.37 |
| 76001 | C3H9O3P | bis(hydroxymethyl)phosphanylmethanol | Tris(hydroxymethyl)phosphine | 124.08 |
| 76006 | C11H17O3P | benzyl diethyl phosphite | Benzyl diethyl phosphite | 228.22 |
| 76017 | C9H11Cl2O2PS3 | (3,4-dichlorophenyl)sulfanylmethylsulfanyl-dimethoxy-thioxo-lambda5-phosphane | Geigy G-30493 | 349.3 |
| 76019 | C10H29N4O4P | N,N'-bis(3-aminopropyl)butane-1,4-diamine;phosphoric acid | 2779-91-1 | 300.34 |
| 76025 | C11H18O4P2S4 | [4-(dimethoxyphosphinothioylsulfanylmethyl)phenyl]sulfanyl-dimethoxy-thioxo-lambda5-phosphane | Shell SD 7,438 | 404.5 |
| 76073 | C8H18NO4PS2 | 2-dimethoxyphosphinothioylsulfanyl-N-isopropyl-N-methoxy-acetamide | Ciba C-2428 | 287.3 |
| 76117 | C10H13Cl3NO3P | N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine | 2864-61-1 | 332.5 |
| 76125 | C4H10NaO4P | sodium diethyl phosphate | sodium diethyl phosphate | 176.08 |
| 76179 | C8H20O4P2S4 | (diethoxyphosphinothioyldisulfanyl)-diethoxy-thioxo-lambda5-phosphane | 2901-90-8 | 370.5 |
| 76211 | C9H11ClNO4PS | (2-chloro-4-nitro-phenoxy)-ethyl-methoxy-thioxo-lambda5-phosphane | O-(2-Chloro-4-nitrophenyl) O-methyl ethylphosphonothioate | 295.68 |
| 76233 | C30H63O3P | tris-decyl phosphite | Tridecyl phosphite | 502.8 |
| 76235 | C12H28O4P2S4Zn | zinc bis(diisopropoxy-sulfido-thioxo-lambda5-phosphane) | Zinc tetraisopropyl bis(dithiophosphate) | 491.9 |
| 76257 | C5H10NO3P | diethoxyphosphorylformonitrile | Diethyl cyanophosphonate | 163.11 |
| 76277 | C8H11O2P | dimethoxy(phenyl)phosphane | Dimethyl phenylphosphonite | 170.15 |
| 76282 | C12H15O3P | diallyloxyphosphorylbenzene | Diallyl phenylphosphonate | 238.22 |
| 76286 | C9H12ClO3PS2 | (3-chloro-4-methylsulfanyl-phenoxy)-dimethoxy-thioxo-lambda5-phosphane | Bayer 29491 | 298.7 |
| 76290 | C18H39O4P | octadecyl dihydrogen phosphate | Octadecyl dihydrogen phosphate | 350.5 |
| 76293 | C19H17OP | diphenylphosphorylmethylbenzene | 2959-74-2 | 292.3 |
| 76294 | C15H17OP | [isopropyl(phenyl)phosphoryl]benzene | Isopropyldiphenylphosphine oxide | 244.27 |
| 76327 | C10H15OPS2 | ethyl-methoxy-(p-tolylsulfanyl)-thioxo-lambda5-phosphane | O-Methyl S-(4-methylphenyl) ethylphosphonodithioate | 246.3 |
| 76328 | C13H21OPS2 | (4-tert-butylphenyl)sulfanyl-ethyl-methoxy-thioxo-lambda5-phosphane | 2984-66-9 | 288.4 |
| 76329 | C8H11OPS2 | methoxy-methyl-phenylsulfanyl-thioxo-lambda5-phosphane | O-Methyl S-phenyl methylphosphonodithioate | 218.3 |
| 76350 | C7H14O6P2 | 3,9-dimethyl-2,4,8,10-tetraoxa-3lambda5,9lambda5-diphosphaspiro[5.5]undecane 3,9-dioxide | 3001-98-7 | 256.13 |
| 76390 | C12H18NO5P | 1-[butyl(ethoxy)phosphoryl]oxy-4-nitro-benzene | 3015-74-5 | 287.25 |
| 76391 | C13H20NO5P | 1-[ethoxy(pentyl)phosphoryl]oxy-4-nitro-benzene | 3015-75-6 | 301.27 |
| 76392 | C15H24NO5P | 1-[ethoxy(heptyl)phosphoryl]oxy-4-nitro-benzene | 3015-77-8 | 329.33 |
| 76393 | C16H26NO5P | 1-[ethoxy(octyl)phosphoryl]oxy-4-nitro-benzene | ethyl 4-nitrophenyl octylphosphonate | 343.35 |
| 76399 | CH6N3O3P | guanidinophosphonic acid | Amidinophosphoramidic acid | 139.05 |
| 76413 | C24H51O3P | trioctyl phosphite | 3028-88-4 | 418.6 |
| 76420 | C12H28O4P2S4 | (diisopropoxyphosphinothioyldisulfanyl)-diisopropoxy-thioxo-lambda5-phosphane | 3031-21-8 | 426.6 |
| 76425 | C39H81O4P | tritridecyl phosphate | Tri(tridecyl) phosphate | 645.0 |
| 76433 | C36H75O4P | dioctadecyl hydrogen phosphate | Distearyl phosphate | 603.0 |
| 76438 | C4H9Cl2O4P | bis(2-chloroethyl) hydrogen phosphate | bis(2-chloroethyl) phosphate | 222.99 |
| 76448 | C18H15O3P | [phenoxy(phenyl)phosphoryl]oxybenzene | Diphenyl phenylphosphonate | 310.3 |
| 76452 | C45H69O3P | tris(4-nonylphenyl) phosphite | 3050-88-2 | 689.0 |
| 76464 | C11H15O3P | 5,5-dimethyl-2-phenoxy-1,3,2-dioxaphosphinane | 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosphinane | 226.21 |
| 76487 | C11H17O4PS | diethyl (4-methylsulfanylphenyl) phosphate | 3070-13-1 | 276.29 |
| 76488 | C11H17O3PS2 | diethoxy-(4-methylsulfanylphenoxy)-thioxo-lambda5-phosphane | Fensulfothion sulfide | 292.4 |
| 76493 | C9H20ClO3P | 1-[butoxy(chloromethyl)phosphoryl]oxybutane | Dibutyl chloromethylphosphonate | 242.68 |
| 76495 | C36H75O3P | tridodecyl phosphite | Tridodecyl phosphite | 587.0 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.