Phosphorus + Oxygen Compounds (P + O)
Browse all compounds containing Phosphorus + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
Total Compounds: 57,505
Showing 9,201 - 9,250 of 57,505
Page 185 of 1,151
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 218149 | C6H10Cl3O4P | 3-chloropropyl 2,2-dichlorovinyl methyl phosphate | 3-chloropropyl 2,2-dichloroethenyl methyl phosphate | 283.5 |
| 218176 | C10H20N2NaO3PS | sodium [2-amino-2-(cycloheptylmethylimino)ethyl]sulfanyl-hydroxy-phosphinate | sodium [2-amino-2-(cycloheptylmethylimino)ethyl]sulfanyl-hydroxy-phosphinate | 302.31 |
| 218177 | C10H21N2O3PS | [2-amino-2-(cycloheptylmethylimino)ethyl]sulfanylphosphonic acid | [2-amino-2-(cycloheptylmethylimino)ethyl]sulfanylphosphonic acid | 280.33 |
| 218178 | C16H31Cl2O4P | 2,2-dichlorovinyl diheptyl phosphate | 2,2-Dichlorovinyl diheptyl phosphate | 389.3 |
| 218514 | C10H22ClN2O5PS | 2-[[3-(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-yl]-ethyl-amino]ethyl methanesulfonate | BRN 1085318 | 348.78 |
| 218515 | C9H20ClN2O5PS | [2-[[3-(2-chloroethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-yl]amino]-1-methyl-ethyl] methanesulfonate | BRN 1084748 | 334.76 |
| 218516 | C12H16ClO4P | (2-chloro-1-phenyl-vinyl) diethyl phosphate | SCHEMBL11561182 | 290.68 |
| 218517 | C8H20O7P2 | diisopropoxyphosphoryl dimethyl phosphate | BRN 1714007 | 290.19 |
| 218562 | C4H7Br2O4P | 2,2-dibromovinyl dimethyl phosphate | BRN 1868302 | 309.88 |
| 218563 | C6H11Br2O4P | 2,2-dibromovinyl diethyl phosphate | 2,2-Dibromovinyl diethyl phosphate | 337.93 |
| 218564 | C4H7Br4O4P | dimethyl 1,2,2,2-tetrabromoethyl phosphate | 40806-03-9 | 469.69 |
| 218565 | C6H11Br4O4P | diethyl 1,2,2,2-tetrabromoethyl phosphate | Diethyl 1,2,2,2-tetrabromoethyl phosphate | 497.74 |
| 218624 | C26H30N6O6P2 | 3-[[aziridin-1-yl-[4-[aziridin-1-yl-[[3-oxo-3-(3-pyridyl)propyl]amino]phosphoryl]oxyphenoxy]phosphoryl]amino]-1-(3-pyridyl)propan-1-one | 40951-24-4 | 584.5 |
| 218668 | C3H6O4P2 | 2,6,7-trioxa-1,4lambda5-diphosphabicyclo[2.2.2]octane 4-oxide | Methanol, phosphinylidynetri-, cyclic phosphite | 168.02 |
| 218694 | C13H18ClO2PS3 | (6-chlorothiochroman-4-yl)sulfanyl-diethoxy-thioxo-lambda5-phosphane | Dithicrofos | 368.9 |
| 218930 | C13H22NO2PS | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N,3-dimethyl-aniline | BRN 2738554 | 287.36 |
| 218931 | C13H22NO3PS | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-3-methoxy-N-methyl-aniline | BRN 2746716 | 303.36 |
| 218932 | C12H19ClNO2PS | 3-chloro-N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N-methyl-aniline | BRN 2743008 | 307.78 |
| 218933 | C13H22NO2PS | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N,4-dimethyl-aniline | BRN 2127423 | 287.36 |
| 218934 | C13H22NO3PS | N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-4-methoxy-N-methyl-aniline | BRN 2139080 | 303.36 |
| 218935 | C12H19ClNO2PS | 4-chloro-N-[2-[ethoxy(methyl)phosphoryl]sulfanylethyl]-N-methyl-aniline | BRN 2134299 | 307.78 |
| 219001 | C8H17O3PS | [methoxy(methylsulfanyl)phosphoryl]oxycyclohexane | Phosphorothioic acid, O-cyclohexyl O,S-dimethyl ester | 224.26 |
| 219008 | C6H18O13P4 | dimethoxyphosphoryl [dimethoxyphosphoryloxy(methoxy)phosphoryl] methyl phosphate | pentamethyl methyltetraphosphate | 422.09 |
| 219028 | C50H68N5O10P | [(2R)-2,3-bis[[4-(4-octoxyphenyl)azobenzoyl]oxy]propyl] 2-(trimethylammonio)ethyl phosphate | 117894-50-5 | 930.1 |
| 219029 | C50H69N5O10P+ | 2-[[(2R)-2,3-bis[[4-(4-octoxyphenyl)azobenzoyl]oxy]propoxy]-hydroxy-phosphoryl]oxyethyl-trimethyl-ammonium | 2-[[(2R)-2,3-bis[[4-(4-octoxyphenyl)azobenzoyl]oxy]propoxy]-hydroxy-phosphoryl]oxyethyl-trimethyl-ammonium | 931.1 |
| 219038 | K3LaO8P2 | tripotassium;lanthanum(3+);diphosphate | Lanthanum tripotassium bis(phosphate) | 446.14 |
| 219041 | C8H13N2O4P | diethyl pyrazin-2-yl phosphate | Thionazin-oxon | 232.17 |
| 219074 | C7H13O3P | [cyclohex-3-en-1-yl(hydroxy)methyl]phosphinic acid | [cyclohex-3-en-1-yl(hydroxy)methyl]phosphinic acid | 176.15 |
| 219090 | C23H22F7N4O6P | [5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-3-oxo-1H-1,2,4-triazol-2-yl]phosphonic acid | [5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-3-oxo-1H-1,2,4-triazol-2-yl]phosphonic acid | 614.4 |
| 219201 | C10H15ClNO3P | 3-chloro-N-diethoxyphosphoryl-aniline | NSC170 | 263.66 |
| 219230 | C20H18ClN2O3P | 1-chloro-4-[N-(diphenoxyphosphorylamino)-C-methyl-carbonimidoyl]benzene | 1-chloro-4-[N-(diphenoxyphosphorylamino)-C-methyl-carbonimidoyl]benzene | 400.8 |
| 219231 | C18H22NO3P | N-diphenoxyphosphorylcyclohexanamine | MLS002637497 | 331.3 |
| 219232 | C12H25N2O4P | 4-[butoxy(morpholino)phosphoryl]morpholine | 5326-05-6 | 292.31 |
| 219233 | C8H12NO2P | [amino(ethoxy)phosphoryl]benzene | Ethyl P-phenylphosphonamidoate | 185.16 |
| 219308 | C24H36N4O7P2 | N-[[(diisopropylamino)-(4-nitrophenyl)phosphoryl]oxy-(4-nitrophenyl)phosphoryl]-N-isopropyl-propan-2-amine | 5337-16-6 | 554.5 |
| 220000 | C12H9N2O6P | bis(4-nitrophenyl)phosphinic acid | Phosphinic acid, bis(p-nitrophenyl)- | 308.18 |
| 220015 | C12H30O8P2 | butyl dihydrogen phosphate;dibutyl hydrogen phosphate | NSC 2182 | 364.31 |
| 220208 | C21H21O3PS | tris(3-methylphenoxy)-thioxo-lambda5-phosphane | 597-81-9 | 384.4 |
| 220215 | C36H43O4P | bis(4-tert-butylphenyl) (4-tert-butyl-2-phenyl-phenyl) phosphate | 5330-22-3 | 570.7 |
| 220223 | C16H35O3P | 3-(2-ethylhexoxyphosphonoyloxymethyl)heptane | 3-(2-ethylhexoxyphosphonoyloxymethyl)heptane | 306.42 |
| 220224 | C4H11O3P | 1-ethoxyphosphonoyloxyethane | 1-ethoxyphosphonoyloxyethane | 138.10 |
| 220226 | C11H15O4P | diethoxyphosphoryl(phenyl)methanone | Diethyl benzoylphosphonate | 242.21 |
| 220229 | C19H26ClN2O3P | (4-chlorophenyl)carbamoyl-phenyl-phosphinic acid;N,N-diethylethanamine | MLS002637639 | 396.8 |
| 220300 | C21H39O10P | butyl 2-bis(2-butoxy-1-methyl-2-oxo-ethoxy)phosphoryloxypropanoate | 5324-03-8 | 482.5 |
| 220450 | C6H15O3P | dipropyl hydrogen phosphite | dipropyl hydrogen phosphite | 166.16 |
| 220451 | C14H32O6P2 | 1,6-bis(diethoxyphosphoryl)hexane | 1,6-bis(diethoxyphosphoryl)hexane | 358.35 |
| 220452 | C15H34O6P2 | 1,3-bis(dipropoxyphosphoryl)propane | NSC3229 | 372.37 |
| 220453 | C18H39O3P | bis(3,5,5-trimethylhexyl) hydrogen phosphite | 5391-94-6 | 334.5 |
| 220454 | C18H40O6P2 | 1-[butoxy(2-dibutoxyphosphorylethyl)phosphoryl]oxybutane | 919-48-2 | 414.5 |
| 220455 | C22H31O2PS2 | bis(2-tert-butyl-5-methyl-phenoxy)-sulfanyl-thioxo-lambda5-phosphane | 6291-43-6 | 422.6 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.