Nitrogen + Oxygen Compounds (N + O)
Browse all compounds containing Nitrogen + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 32155 | C27H29ClN2O4 | but-2-enedioate;[(4-chlorophenyl)-phenyl-methyl]-[2-[(2,6-dimethylphenyl)ammonio]ethyl]ammonium | but-2-enedioate;[(4-chlorophenyl)-phenyl-methyl]-[2-[(2,6-dimethylphenyl)ammonio]ethyl]ammonium | 481.0 |
| 32157 | C12H18ClNO4 | 2-(2-hydroxy-3-methoxy-benzoyl)oxyethyl-dimethyl-ammonium chloride | 23958-95-4 | 275.73 |
| 32158 | C12H17NO4 | 2-(dimethylamino)ethyl 2-hydroxy-3-methoxy-benzoate | 2-(dimethylamino)ethyl 2-hydroxy-3-methoxy-benzoate | 239.27 |
| 32159 | C14H22ClNO4 | 2-(2-ethoxy-3-methoxy-benzoyl)oxyethyl-dimethyl-ammonium chloride | 23958-98-7 | 303.78 |
| 32160 | C14H21NO4 | 2-(dimethylamino)ethyl 2-ethoxy-3-methoxy-benzoate | 2-(dimethylamino)ethyl 2-ethoxy-3-methoxy-benzoate | 267.32 |
| 32161 | C14H20ClNO5 | 2-morpholin-4-ium-4-ylethyl 2-hydroxy-3-methoxy-benzoate chloride | 23959-15-1 | 317.76 |
| 32162 | C14H19NO5 | 2-morpholinoethyl 2-hydroxy-3-methoxy-benzoate | 2-morpholinoethyl 2-hydroxy-3-methoxy-benzoate | 281.30 |
| 32163 | C16H26ClNO4 | 2-(2-butoxy-3-methoxy-benzoyl)oxyethyl-dimethyl-ammonium chloride | 23959-17-3 | 331.8 |
| 32164 | C16H25NO4 | 2-(dimethylamino)ethyl 2-butoxy-3-methoxy-benzoate | 2-(dimethylamino)ethyl 2-butoxy-3-methoxy-benzoate | 295.37 |
| 32165 | C17H28ClNO4 | diethyl-[2-(3-methoxy-2-propoxy-benzoyl)oxyethyl]ammonium chloride | 23959-22-0 | 345.9 |
| 32166 | C17H27NO4 | 2-(diethylamino)ethyl 3-methoxy-2-propoxy-benzoate | 2-(diethylamino)ethyl 3-methoxy-2-propoxy-benzoate | 309.4 |
| 32167 | C17H26ClNO5 | 2-morpholin-4-ium-4-ylethyl 3-methoxy-2-propoxy-benzoate chloride | BENZOIC ACID, 3-METHOXY-2-PROPOXY-, 2-MORPHOLINOETHYL ESTER, HYDROCHLORIDE | 359.8 |
| 32168 | C17H25NO5 | 2-morpholinoethyl 3-methoxy-2-propoxy-benzoate | 2-morpholinoethyl 3-methoxy-2-propoxy-benzoate | 323.4 |
| 32169 | C13H21ClN2O3S | methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate;hydrochloride | ARTICAINE HYDROCHLORIDE | 320.84 |
| 32170 | C13H20N2O3S | methyl 4-methyl-3-[2-(propylamino)propanoylamino]thiophene-2-carboxylate | Articaine | 284.38 |
| 32171 | C18H28ClNO5 | 2-morpholin-4-ium-4-ylethyl 2-butoxy-3-methoxy-benzoate chloride | 23966-68-9 | 373.9 |
| 32172 | C18H27NO5 | 2-morpholinoethyl 2-butoxy-3-methoxy-benzoate | 2-morpholinoethyl 2-butoxy-3-methoxy-benzoate | 337.4 |
| 32173 | C17H28INO4 | 2-(dimethylamino)ethyl 2-butoxy-3-methoxy-benzoate;iodomethane | 23966-69-0 | 437.3 |
| 32174 | C17H28ClNO4 | 2-(2-butoxy-3-methoxy-benzoyl)oxyethyl-isopropyl-ammonium chloride | 23966-71-4 | 345.9 |
| 32175 | C17H27NO4 | 2-(isopropylamino)ethyl 2-butoxy-3-methoxy-benzoate | 2-(isopropylamino)ethyl 2-butoxy-3-methoxy-benzoate | 309.4 |
| 32179 | C21H41ClN2O4 | 5-(diisobutylamino)penta-2,4-dienylidene-diisobutyl-ammonium perchlorate | 5-(diisobutylamino)penta-2,4-dienylidene-diisobutyl-ammonium perchlorate | 421.0 |
| 32181 | C18H15N3O2S | 5-benzamido-3-methyl-N-phenyl-isothiazole-4-carboxamide | BRN 1146753 | 337.4 |
| 32182 | C18H21N3O2S | 5-benzamido-N-cyclohexyl-3-methyl-isothiazole-4-carboxamide | BRN 1164204 | 343.4 |
| 32183 | C16H15NO3 | 2-(N-(2-phenylacetyl)anilino)acetic acid | Phenylacetyl-D-phenylglycine | 269.29 |
| 32184 | C12H16N3O3PS | diethoxy-[(1-phenyl-1,2,4-triazol-3-yl)oxy]-thioxo-lambda5-phosphane | Triazophos | 313.31 |
| 32185 | C42H42N12Na2O8S2 | disodium;5-[[4-(2-methylanilino)-6-morpholino-1,3,5-triazin-2-yl]amino]-2-[2-[4-[[4-(2-methylanilino)-6-morpholino-1,3,5-triazin-2-yl]amino]-2-sulfonato-phenyl]vinyl]benzenesulfonate | C.I. FLUORESCENT BRIGHTENER 225 | 953.0 |
| 32186 | C42H44N12O8S2 | 5-[[4-(2-methylanilino)-6-morpholino-1,3,5-triazin-2-yl]amino]-2-[2-[4-[[4-(2-methylanilino)-6-morpholino-1,3,5-triazin-2-yl]amino]-2-sulfo-phenyl]vinyl]benzenesulfonic acid | 2,2'-(1,2-Ethenediyl)bis[5-[[4-[(2-methylphenyl)amino]-6-(4-morpholinyl)-1,3,5-triazin-2-yl]amino]benzenesulfonic acid] | 909.0 |
| 32187 | C14H22ClNO4 | diethyl-[2-(2-hydroxy-3-methoxy-benzoyl)oxyethyl]ammonium chloride | 24022-35-3 | 303.78 |
| 32188 | C14H21NO4 | 2-(diethylamino)ethyl 2-hydroxy-3-methoxy-benzoate | 2-(diethylamino)ethyl 2-hydroxy-3-methoxy-benzoate | 267.32 |
| 32189 | C16H26ClNO4 | 2-(2-ethoxy-3-methoxy-benzoyl)oxyethyl-diethyl-ammonium chloride | 24022-37-5 | 331.8 |
| 32190 | C16H25NO4 | 2-(diethylamino)ethyl 2-ethoxy-3-methoxy-benzoate | 2-(diethylamino)ethyl 2-ethoxy-3-methoxy-benzoate | 295.37 |
| 32194 | C16H13N3O2S2 | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(2-hydroxyphenyl)methyleneamino]acetamide | ZINC00059274 | 343.4 |
| 32197 | C28H34ClNO5 | 3,3-diphenylpropyl-[3-(3,4,5-trimethoxybenzoyl)oxypropyl]ammonium chloride | Benzoic acid, 3,4,5-trimethoxy-, 3-((3,3-diphenylpropyl)amino)propyl ester, hydrochloride | 500.0 |
| 32198 | C28H33NO5 | 3-(3,3-diphenylpropylamino)propyl 3,4,5-trimethoxybenzoate | Mepramidil | 463.6 |
| 32200 | C15H24ClNO4 | 2-(3-methoxy-2-propoxy-benzoyl)oxyethyl-dimethyl-ammonium chloride | 24063-41-0 | 317.81 |
| 32201 | C15H23NO4 | 2-(dimethylamino)ethyl 3-methoxy-2-propoxy-benzoate | 2-(dimethylamino)ethyl 3-methoxy-2-propoxy-benzoate | 281.35 |
| 32202 | C5H7NO2S | ethyl 2-isothiocyanatoacetate | Ethyl isothiocyanatoacetate | 145.18 |
| 32203 | C7H10ClN3O | [N'-(4-hydroxyphenyl)carbamimidoyl]ammonium chloride | [N'-(4-hydroxyphenyl)carbamimidoyl]ammonium chloride | 187.63 |
| 32204 | C7H9N3O | 2-(4-hydroxyphenyl)guanidine | CHEMBL2323124 | 151.17 |
| 32208 | C15H11NO3 | 1-amino-2-(hydroxymethyl)anthracene-9,10-dione | 24094-44-8 | 253.25 |
| 32210 | C12H18ClN3O2 | N-(4-chloro-2-nitro-phenyl)-N',N'-diethyl-ethane-1,2-diamine | 4-Chloro-N-(diethylaminoethyl)-2-nitroaniline | 271.74 |
| 32211 | C20H25ClN2O4 | 2-[2-methoxycarbonyl-4-(o-tolylcarbamoyl)phenoxy]ethyl-dimethyl-ammonium chloride | SCO 940 | 392.9 |
| 32212 | C20H24N2O4 | methyl 2-[2-(dimethylamino)ethoxy]-5-(o-tolylcarbamoyl)benzoate | methyl 2-[2-(dimethylamino)ethoxy]-5-(o-tolylcarbamoyl)benzoate | 356.4 |
| 32213 | C7H10F3NO2 | 2,2,2-trifluoroethyl 3-(aziridin-1-yl)propanoate | 1-AZIRIDINEPROPIONIC ACID, 2,2,2-TRIFLUOROETHYL ESTER | 197.15 |
| 32214 | C11H19NO2 | cyclohexyl 3-(aziridin-1-yl)propanoate | 1-AZIRIDINEPROPIONIC ACID, CYCLOHEXYL ESTER | 197.27 |
| 32215 | C12H15NO2 | benzyl 3-(aziridin-1-yl)propanoate | 1-AZIRIDINEPROPIONIC ACID, BENZYL ESTER | 205.25 |
| 32216 | C8H15NO3 | 2-methoxyethyl 3-(aziridin-1-yl)propanoate | 1-AZIRIDINEPROPIONIC ACID, 2-METHOXYETHYL ESTER | 173.21 |
| 32217 | C8H11F4NO2 | 2,2,3,3-tetrafluoropropyl 3-(aziridin-1-yl)propanoate | 1-AZIRIDINEPROPIONIC ACID, 2,2,3,3-TETRAFLUOROPROPYL ESTER | 229.17 |
| 32218 | C8H10F5NO2 | 2,2,3,3,3-pentafluoropropyl 3-(aziridin-1-yl)propanoate | 24116-27-6 | 247.16 |
| 32219 | C9H5Cl4NO2 | 3,3-dichloro-2-(2,4-dichlorophenyl)oxirane-2-carboxamide | 24119-95-7 | 300.9 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.