Nitrogen + Oxygen Compounds (N + O)
Browse all compounds containing Nitrogen + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
We're currently updating our database. We've sourced 10 million compounds so far, with the full 170 million coming shortly.
Total Compounds: 6,179,671
Showing 124,851 - 124,900 of 6,179,671
Page 2498 of 123,594
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 219915 | C15H27NO2S | dodecyl 2-thiocyanatoacetate | dodecyl thiocyanatoacetate | 285.4 |
| 219916 | C10H17NO2S | hexyl 2-thiocyanatopropanoate | hexyl 2-thiocyanatopropanoate | 215.31 |
| 219917 | C11H22BrNO | 2-bromo-N,N-disec-butyl-propanamide | 5396-44-1 | 264.20 |
| 219918 | C9H18BrNO | 2-bromo-N-(2-ethylbutyl)propanamide | 5345-69-7 | 236.15 |
| 219919 | C10H20BrNO | 2-bromo-N-heptyl-propanamide | 2-BROMO-N-HEPTYLPROPIONAMIDE | 250.18 |
| 219920 | C6H11Cl2NO | N-butyl-2,2-dichloro-acetamide | 5345-74-4 | 184.06 |
| 219921 | C13H6Cl2N2O7 | bis(2-chloro-5-nitro-phenyl) carbonate | NSC1731 | 373.10 |
| 219922 | C9H9NO4 | 2-[(2-nitrophenoxy)methyl]oxirane | 21407-49-8 | 195.17 |
| 219925 | C24H19N3O6S | 7-[[4-[(4-aminobenzoyl)amino]benzoyl]amino]-4-hydroxy-naphthalene-2-sulfonic acid | 91-45-2 | 477.5 |
| 219926 | C16H13NO4S | 6-anilino-4-hydroxy-naphthalene-1-sulfonic acid | 5345-77-7 | 315.3 |
| 219927 | C24H33NO16 | (8-acetamido-2,3,4,5,6,7-hexaacetoxy-8-oxo-octyl) acetate | 5345-80-2 | 591.5 |
| 219939 | C17H16N2O | 3-(3-phenanthryl)propanehydrazide | NSC1760 | 264.32 |
| 219940 | C20H23NO2 | 6-[2-(diethylamino)-1-hydroxy-ethyl]phenanthren-3-ol | MLS002637592 | 309.4 |
| 219942 | C18H39NO | 2-(dioctylamino)ethanol | 2-(DIOCTYLAMINO)ETHANOL | 285.5 |
| 219948 | C13H11NO | N-(2-phenylphenyl)formamide | 2'-PHENYLFORMANILIDE | 197.23 |
| 219952 | C18H31NO | 4-(dibutylamino)-1-phenyl-butan-1-ol | 5328-93-8 | 277.4 |
| 219953 | C15H13NO2 | 3-(2-aminophenyl)-2-phenyl-prop-2-enoic acid | alpha-phenyl-2-aminocinnamic acid | 239.27 |
| 219954 | C22H36N2O | 6-methoxy-1-[7-(1-piperidyl)heptyl]-3,4-dihydro-2H-quinoline | 5329-06-6 | 344.5 |
| 219956 | C9H12N2O2 | N-(4-amino-2-methoxy-phenyl)acetamide | N-(4-amino-2-methoxyphenyl)acetamide | 180.20 |
| 219958 | C15H14N2O6 | 4-[1-(4-hydroxy-3-nitro-phenyl)-1-methyl-ethyl]-2-nitro-phenol | 5329-21-5 | 318.28 |
| 219961 | C4H4N2OS | 2-sulfanyl-5H-pyrimidin-4-one | 2-sulfanyl-5H-pyrimidin-4-one | 128.15 |
| 219962 | C17H11NO | phenanthro[9,10-b]pyridin-7-ol | Dibenzo[f,h]quinolin-7-ol | 245.27 |
| 219963 | C15H11NO | phenanthrene-9-carboxamide | 9-Phenanthrenecarboxamide | 221.25 |
| 219965 | C15H15NO2 | acetic acid;5,6-dihydrophenanthridine | 5328-29-0 | 241.28 |
| 219967 | C17H16N2O | 3-(9-phenanthryl)propanehydrazide | 5328-30-3 | 264.32 |
| 219970 | C18H19NO | 2-(dimethylamino)-1-(9-phenanthryl)ethanol | NSC1931 | 265.3 |
| 219971 | C14H11NO2S | 1-(5-oxophenothiazin-10-yl)ethanone | Phenothiazine, 10-acetyl-, 5-oxide | 257.31 |
| 219972 | C2H6N4O2 | 1-amino-3-carbamoyl-urea | 1-amino-3-carbamoylurea | 118.10 |
| 219973 | C12H15NO8 | 2-(hydroxymethyl)-6-(2-nitrophenoxy)tetrahydropyran-3,4,5-triol | 666699-73-6 | 301.25 |
| 219976 | C13H20N2O7 | 2,3,4,5,6,7-hexahydroxy-N'-phenyl-heptanehydrazide | 6631-62-5 | 316.31 |
| 219979 | C13H20N2O7S | 4-methyl-N-(2,3,4,5,6-pentahydroxyhexylideneamino)benzenesulfonamide | D-glucose-(toluene-4-sulfonylhydrazone) | 348.37 |
| 219980 | C13H20N2O6 | 2,3,4,5,6-pentahydroxy-N'-phenyl-heptanehydrazide | 2,3,4,5,6-pentahydroxy-N'-phenylheptanehydrazide | 300.31 |
| 219981 | C19H24N4O4 | 7-phenylazo-6-(2-phenylhydrazino)hept-6-ene-2,3,4,5-tetrol | 7-phenylazo-6-(2-phenylhydrazino)hept-6-ene-2,3,4,5-tetrol | 372.4 |
| 219987 | C8H16N2O4S | 4-morpholinosulfonylmorpholine | 4,4'-Sulfonylbis-morpholine | 236.29 |
| 219988 | C10H6BrNO2 | 1-bromo-5-nitro-naphthalene | 1-Bromo-5-nitronaphthalene | 252.06 |
| 219989 | C6H3Cl2NO2 | 3,5-dichloropyridine-2-carboxylic acid | 81719-53-1 | 192.00 |
| 219990 | C12H10N2O | N-(2-pyridyl)benzamide | N-(pyridin-2-yl)benzamide | 198.22 |
| 219997 | C13H12N2O6 | ethyl 6-methoxy-8-nitro-4-oxo-1H-quinoline-3-carboxylate | ethyl 6-methoxy-8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate | 292.24 |
| 220000 | C12H9N2O6P | bis(4-nitrophenyl)phosphinic acid | Phosphinic acid, bis(p-nitrophenyl)- | 308.18 |
| 220008 | C9H13NO | 2-(4-methylanilino)ethanol | Ethanol, 2-[(4-methylphenyl)amino]- | 151.21 |
| 220009 | C18H39NO | 10-(dibutylamino)decan-1-ol | 5341-91-3 | 285.5 |
| 220017 | C11H11NO2 | 6-methoxy-4-methyl-1H-quinolin-2-one | 2-HYDROXY-6-METHOXY-4-METHYLQUINOLINE | 189.21 |
| 220023 | C14H15NO2S | N,4-dimethyl-N-phenyl-benzenesulfonamide | N,4-Dimethyl-N-phenylbenzenesulfonamide | 261.34 |
| 220025 | C10H19NO2 | 2-[1-(hydroxyamino)-1-methyl-ethyl]-5-methyl-cyclohexanone | 2-[2-(hydroxyamino)propan-2-yl]-5-methylcyclohexanone | 185.26 |
| 220035 | C8H12N2OS | 3-[2-(2-cyanoethylsulfanyl)ethoxy]propanenitrile | 62508-38-7 | 184.26 |
| 220053 | C7H11NO2S | ethyl 2-(2-cyanoethylsulfanyl)acetate | 5331-38-4 | 173.24 |
| 220055 | C10H9NO2 | 2-cyano-3-phenyl-propanoic acid | 2-Cyano-3-phenylpropionic acid | 175.18 |
| 220056 | C5H10N2O2 | ethyl N-(ethylideneamino)carbamate | 3206-27-7 | 130.15 |
| 220058 | C6H10N2O | 3-(isopropylideneamino)oxypropanenitrile | 3-[(isopropylideneamino)oxy]propanenitrile | 126.16 |
| 220064 | C13H16N2O4 | diethyl 2-(phenylhydrazono)propanedioate | Diethyl 2-(2-phenylhydrazono)malonate | 264.28 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.