Nitrogen + Hydrogen Compounds (N + H)
Browse all compounds containing Nitrogen + Hydrogen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
We're currently updating our database. We've sourced 10 million compounds so far, with the full 170 million coming shortly.
Total Compounds: 6,529,041
Showing 35,701 - 35,750 of 6,529,041
Page 715 of 130,581
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 50299 | C21H25FN4O3S | N-[2-(dimethylamino)ethyl]-6-fluoro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide;dihydrate | 69099-37-2 | 432.5 |
| 50300 | C21H21FN4OS | N-[2-(dimethylamino)ethyl]-6-fluoro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | N-[2-(dimethylamino)ethyl]-6-fluoro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | 396.5 |
| 50301 | C23H26N4OS | N-[2-(diethylamino)ethyl]-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0585026 | 406.5 |
| 50302 | C24H25F3N4OS | N-[2-(diethylamino)ethyl]-1-phenyl-6-(trifluoromethyl)-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0595459 | 474.5 |
| 50303 | C24H25FN4O2S | 6-fluoro-N-(3-morpholinopropyl)-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0594584 | 452.5 |
| 50304 | C24H26N4OS | N-[(1-ethylpyrrolidin-2-yl)methyl]-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0588101 | 418.6 |
| 50305 | C23H26N4O3S | N-[2-(diethylamino)ethyl]-5,5-dioxo-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0592179 | 438.5 |
| 50306 | C24H26N4O4S | N-(3-morpholinopropyl)-5,5-dioxo-1-phenyl-4H-thiochromeno[3,4-d]pyrazole-3-carboxamide | BRN 0595792 | 466.6 |
| 50307 | C17H21N3O2S | N-[2-(diethylamino)ethyl]-9H-thiochromeno[4,3-d]isoxazole-1-carboxamide | BRN 1026301 | 331.4 |
| 50308 | C25H30N2O4 | 7-methoxy-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-chromen-4-one | BRN 0855991 | 422.5 |
| 50309 | C23H26N2O2 | 3-methyl-2-[3-(4-phenylpiperazin-1-yl)propyl]chromen-4-one | BRN 0833477 | 362.5 |
| 50310 | C23H25FN2O2 | 7-fluoro-3-methyl-2-[3-(4-phenylpiperazin-1-yl)propyl]chromen-4-one | CHROMONE, 7-FLUORO-3-METHYL-2-(3-(4-PHENYL-1-PIPERAZINYL)PROPYL)- | 380.5 |
| 50311 | C6H12Cl2N2O | N,N-bis(2-chloropropyl)nitrous amide | 69112-96-5 | 199.08 |
| 50312 | C9H11FIN3O4 | 4-amino-1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-5-iodo-pyrimidin-2-one | FIACITABINE | 371.10 |
| 50313 | C9H10FIN2O5 | 1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-5-iodo-pyrimidine-2,4-dione | FIALURIDINE | 372.09 |
| 50314 | C9H12Cl2N4 | 1-(2-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-3-ium-2-yl)hydrazine chloride | 2-IMIDAZOLIDINONE, (2-CHLOROPHENYL)HYDRAZONE, MONOHYDROCHLORIDE | 247.12 |
| 50315 | C9H11ClN4 | 1-(2-chlorophenyl)-2-(4,5-dihydro-1H-imidazol-2-yl)hydrazine | SCHEMBL11591507 | 210.66 |
| 50316 | C12H10N4 | 4,5-dimethylcyclohex-4-ene-1,1,2,2-tetracarbonitrile | 1,1,2,2-CYCLOHEX-4-ENETETRACARBONITRILE, 4,5-DIMETHYL- | 210.23 |
| 50317 | C20H24N2 | N,2-dimethyl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)azetidin-3-amine | BRN 0425505 | 292.4 |
| 50318 | C20H24N2O | 1-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-N-methyl-azetidin-3-amine | BRN 0438091 | 308.4 |
| 50319 | C17H20N2 | 1-benzhydryl-N-methyl-azetidin-3-amine | 69159-49-5 | 252.35 |
| 50321 | C15H15Cl2NS | (3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)-methyl-ammonium chloride | VUFB-10541 | 312.3 |
| 50322 | C15H14ClNS | 3-chloro-N-methyl-5,6-dihydrobenzo[b][1]benzothiepin-5-amine | 3-chloro-N-methyl-5,6-dihydrobenzo[b][1]benzothiepin-5-amine | 275.8 |
| 50323 | C15H14Cl2N2S2 | [amino-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)sulfanyl]methylene]ammonium chloride | VUFB-10109 | 357.3 |
| 50324 | C15H13ClN2S2 | 2-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)isothiourea | AE-641/30114007 | 320.9 |
| 50325 | C18H21Cl2NS2 | 2-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)sulfanyl]ethyl-dimethyl-ammonium chloride | VUFB-10108 | 386.4 |
| 50326 | C18H20ClNS2 | 2-[(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)sulfanyl]-N,N-dimethyl-ethanamine | Oprea1_707686 | 349.9 |
| 50327 | C18H16ClNO4S | (3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)ammonium;4-hydroxy-4-oxo-but-2-enoate | (3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)ammonium;4-hydroxy-4-oxo-but-2-enoate | 377.8 |
| 50328 | C14H12ClNS | 3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-amine | UEHJPRSQPKQLIT-UHFFFAOYSA-N | 261.8 |
| 50329 | C14H16ClN | [3-methyl-4-(m-tolyl)phenyl]ammonium chloride | 2,3'-Dimethyl-4-aminobiphenyl hydrochloride | 233.73 |
| 50330 | C14H15N | 3-methyl-4-(m-tolyl)aniline | 73728-77-5 | 197.27 |
| 50333 | C23H23ClN2O5S | 3-chloro-5-(4-methylpiperazin-1-ium-1-yl)benzo[b][1]benzothiepin-9-ol;4-hydroxy-4-oxo-but-2-enoate | 3-chloro-5-(4-methylpiperazin-1-ium-1-yl)benzo[b][1]benzothiepin-9-ol;4-hydroxy-4-oxo-but-2-enoate | 475.0 |
| 50334 | C19H19ClN2OS | 3-chloro-5-(4-methylpiperazin-1-yl)benzo[b][1]benzothiepin-9-ol | 3-chloro-5-(4-methylpiperazin-1-yl)benzo[b][1]benzothiepin-9-ol | 358.9 |
| 50335 | C4H9ClIN | 2-chloro-N-(2-iodoethyl)ethanamine | 2-Chloro-2'-iodo-diethylamine | 233.48 |
| 50336 | C21H20ClN3 | [4-(acridin-9-ylamino)phenyl]-ethyl-ammonium chloride | 69242-87-1 | 349.9 |
| 50337 | C21H19N3 | N4-acridin-9-yl-N1-ethyl-benzene-1,4-diamine | ACRIDINE, 9-(p-(ETHYLAMINO)ANILINO)- | 313.4 |
| 50338 | C22H22ClN3 | [4-(acridin-9-ylamino)phenyl]-propyl-ammonium chloride | 69242-88-2 | 363.9 |
| 50339 | C22H21N3 | N4-acridin-9-yl-N1-propyl-benzene-1,4-diamine | ACRIDINE, 9-(p-(PROPYLAMINO)ANILINO)- | 327.4 |
| 50340 | C25H28ClN3 | [4-(acridin-9-ylamino)phenyl]-hexyl-ammonium chloride | 69242-89-3 | 406.0 |
| 50341 | C25H27N3 | N4-acridin-9-yl-N1-hexyl-benzene-1,4-diamine | 9-(p-(Hexylamino)anilino)acridine | 369.5 |
| 50342 | C27H33N3O6S2 | acridin-9-yl-[4-(hexylsulfonylamino)-2-methoxy-phenyl]ammonium;methanesulfonate | 69242-94-0 | 559.7 |
| 50343 | C26H29N3O3S | N-[4-(acridin-9-ylamino)-3-methoxy-phenyl]hexane-1-sulfonamide | CHEMBL107122 | 463.6 |
| 50344 | C24H25ClN4O4S | (4-carbamoylacridin-9-yl)-[2-methoxy-4-(propylsulfonylamino)phenyl]ammonium chloride | 4-Acridinecarboxamide, 9-(2-methoxy-4-(propylsulfonamido)anilino)-, hydrochloride | 501.0 |
| 50345 | C24H24N4O4S | 9-[2-methoxy-4-(propylsulfonylamino)anilino]acridine-4-carboxamide | CHEMBL107163 | 464.5 |
| 50346 | C25H27ClN4O4S | [4-(butylsulfonylamino)-2-methoxy-phenyl]-(4-carbamoylacridin-9-yl)ammonium chloride | 4-Acridinecarboxamide, 9-((4-((butylsulfonyl)amino)-2-methoxyphenyl)amino)-, hydrochloride | 515.0 |
| 50347 | C25H26N4O4S | 9-[4-(butylsulfonylamino)-2-methoxy-anilino]acridine-4-carboxamide | CHEMBL320072 | 478.6 |
| 50348 | C26H29ClN4O4S | (4-carbamoylacridin-9-yl)-[2-methoxy-4-(pentylsulfonylamino)phenyl]ammonium chloride | 4-Acridinecarboxamide, 9-((2-methoxy-4-((pentylsulfonyl)amino)phenyl)amino)-, hydrochloride | 529.1 |
| 50349 | C26H28N4O4S | 9-[2-methoxy-4-(pentylsulfonylamino)anilino]acridine-4-carboxamide | CHEMBL106677 | 492.6 |
| 50350 | C10H13NO2 | N-[2-(2-hydroxyethyl)phenyl]acetamide | 69258-86-2 | 179.22 |
| 50354 | C12H7NO3 | 2-nitrobenzo[e]benzofuran | 2-Nitronaphtho(2,1-b)furan | 213.19 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.