Hydrogen + Oxygen Compounds (H + O)
Browse all compounds containing Hydrogen + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 74406 | C5H6O4 | pent-2-enedioic acid | Pentenedioic acid | 130.10 |
| 74407 | C11H20O4 | dipropyl pentanedioate | Dipropyl glutarate | 216.27 |
| 74408 | C15H28O3 | 1,8-dioxacycloheptadecan-9-one | 10-Oxahexadecanolide | 256.38 |
| 74409 | C11H20O2 | oxacyclododecan-2-one | Oxacyclododecan-2-one | 184.27 |
| 74410 | C3H3IO | 3-iodoprop-2-yn-1-ol | 3-Iodo-2-propynol | 181.96 |
| 74411 | C21H30O6 | tributyl benzene-1,2,4-tricarboxylate | Trimellitic acid tri-n-butyl ester | 378.5 |
| 74414 | C11H14O | 6-methoxytetralin | 6-Methoxy-1,2,3,4-tetrahydronaphthalene | 162.23 |
| 74415 | C14H26O4 | dimethyl dodecanedioate | Dimethyl dodecanedioate | 258.35 |
| 74416 | C9H16O4 | dimethyl heptanedioate | Dimethyl pimelate | 188.22 |
| 74418 | C18H13NO | N-pyren-2-ylacetamide | N-Pyren-2-ylacetamide | 259.3 |
| 74420 | C20H10O10 | 2-(1,3-dioxoisobenzofuran-5-carbonyl)oxyethyl 1,3-dioxoisobenzofuran-5-carboxylate | 1732-96-3 | 410.3 |
| 74421 | C23H14O12 | [2-acetoxy-3-(1,3-dioxoisobenzofuran-5-carbonyl)oxy-propyl] 1,3-dioxoisobenzofuran-5-carboxylate | 1732-97-4 | 482.3 |
| 74422 | C9H14O6 | trimethyl propane-1,1,3-tricarboxylate | 1733-16-0 | 218.20 |
| 74423 | C14H15OP | [ethyl(phenyl)phosphoryl]benzene | Ethyldiphenylphosphine oxide | 230.24 |
| 74425 | C6H5KO4S | potassium phenyl sulfate | potassium phenyl sulfate | 212.27 |
| 74426 | C6H6O4S | phenyl hydrogen sulfate | phenyl hydrogen sulfate | 174.18 |
| 74427 | C10H7KO4S | potassium 2-naphthyl sulfate | potassium 2-naphthyl sulfate | 262.33 |
| 74428 | C10H8O4S | 2-naphthyl hydrogen sulfate | 2-Naphthyl sulfate | 224.23 |
| 74429 | C18H39NO3 | 2-[2-dodecoxyethyl(2-hydroxyethyl)amino]ethanol | 1733-93-3 | 317.5 |
| 74430 | C18H24ClNO | N,N-diethyl-2-(2-phenylphenoxy)ethanamine;hydrochloride | Dacorene hydrochloride | 305.8 |
| 74431 | C18H23NO | N,N-diethyl-2-(2-phenylphenoxy)ethanamine | Dacorene | 269.4 |
| 74432 | C14H8F6O4S | 1-(trifluoromethoxy)-4-[4-(trifluoromethoxy)phenyl]sulfonyl-benzene | 1735-37-1 | 386.27 |
| 74433 | C9H6F3NO4 | 2-[2-nitro-4-(trifluoromethyl)phenyl]acetic acid | 1735-91-7 | 249.14 |
| 74437 | C9H8F3NO2 | N-[4-(trifluoromethoxy)phenyl]acetamide | 1737-06-0 | 219.16 |
| 74438 | C9H8F4O | 1-methyl-3-(1,1,2,2-tetrafluoroethoxy)benzene | 1-methyl-3-(1,1,2,2-tetrafluoroethoxy)benzene | 208.15 |
| 74439 | C9H8F4O | 1-methyl-4-(1,1,2,2-tetrafluoroethoxy)benzene | 4-(1,1,2,2-Tetrafluoroethoxy)toluene | 208.15 |
| 74440 | C9H9FN2O2 | 2-fluoro-N-(phenylcarbamoyl)acetamide | Urea, 1-(fluoroacetyl)-3-phenyl- | 196.18 |
| 74442 | C3H5NO | 2-methoxyacetonitrile | Methoxyacetonitrile | 71.08 |
| 74445 | C8H8N2O2 | benzene-1,3-dicarboxamide | Isophthalamide | 164.16 |
| 74446 | C10H14O | 4-isopropyl-2-methyl-phenol | 1740-97-2 | 150.22 |
| 74447 | C5H11O4PS2 | dimethoxyphosphinothioylsulfanylmethyl acetate | 1741-11-3 | 230.2 |
| 74453 | C12H17FO2 | 1-(2,2-diethoxyethyl)-4-fluoro-benzene | 1-(2,2-Diethoxyethyl)-4-fluorobenzene | 212.26 |
| 74457 | C21H24O2 | 2-allyl-4-[1-(3-allyl-4-hydroxy-phenyl)-1-methyl-ethyl]phenol | 1745-89-7 | 308.4 |
| 74458 | C9H10O | allyloxybenzene | Allyl phenyl ether | 134.17 |
| 74461 | C12H11NO2 | 4-(4-hydroxyanilino)phenol | 4,4'-Iminodiphenol | 201.22 |
| 74463 | C12H10N2O | N-phenylpyridine-3-carboxamide | N-Phenylnicotinamide | 198.22 |
| 74464 | C13H13N3O3 | 5-[[4-(dimethylamino)phenyl]methylene]hexahydropyrimidine-2,4,6-trione | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[[4-(dimethylamino)phenyl]methylene]- | 259.26 |
| 74465 | C12H16O2 | ethyl 2,4,6-trimethylbenzoate | Ethyl 2,4,6-trimethylbenzoate | 192.25 |
| 74466 | C24H26O6 | bis(2,4-dimethoxyphenyl)-(2-methoxyphenyl)methanol | Pentamethoxy Red | 410.5 |
| 74467 | C11H14O2 | 2-ethoxy-4-prop-1-enyl-phenol | SCHEMBL6560457 | 178.23 |
| 74468 | C16H13NO | 1-methyl-2-phenyl-indole-3-carbaldehyde | 1757-72-8 | 235.28 |
| 74469 | C10H12O4 | 2-(2,5-dimethoxyphenyl)acetic acid | 2,5-Dimethoxyphenylacetic acid | 196.20 |
| 74470 | C28H43O4P | bis[4-(1,1,3,3-tetramethylbutyl)phenyl] hydrogen phosphate | 1758-45-8 | 474.6 |
| 74471 | C6H8As2O6 | (2-arsonophenyl)arsonic acid | o-Phenylenediarsonic acid | 325.97 |
| 74472 | C12H22O2 | cyclohexylperoxycyclohexane | Dicyclohexyl peroxide | 198.30 |
| 74473 | C14H10N2O2 | 1,6-diaminoanthracene-9,10-dione | 1758-64-1 | 238.24 |
| 74474 | C11H12ClNO2 | (4-chlorophenyl) pyrrolidine-1-carboxylate | 1759-02-0 | 225.67 |
| 74475 | C12H6Cl2N2O6S | 1-chloro-4-(4-chloro-3-nitro-phenyl)sulfonyl-2-nitro-benzene | Bis(4-chloro-3-nitrophenyl) sulphone | 377.2 |
| 74476 | C6H3F7O | 1,3,3,4,4,5,5-heptafluoro-2-methoxy-cyclopentene | 1759-60-0 | 224.08 |
| 74477 | C14H10O3 | 8-isopropenylfuro[2,3-h]chromen-2-one | Oroselone | 226.23 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.