Fluorine Compounds (F)
Browse all compounds containing Fluorine by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 52046 | C15H9ClF3NO | N-(1-chloro-9H-fluoren-2-yl)-2,2,2-trifluoro-acetamide | ACETAMIDE, N-(CHLOROFLUOREN-2-YL)-2,2,2-TRIFLUORO- | 311.68 |
| 52051 | C14H19F3N2O | N,N-dimethyl-2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]acetamide | 73664-44-5 | 288.31 |
| 52071 | C8H5F3NNaO | sodium N-oxido-1-[3-(trifluoromethyl)phenyl]methanimine | sodium N-oxido-1-[3-(trifluoromethyl)phenyl]methanimine | 211.12 |
| 52072 | C8H5F3NO- | N-oxido-1-[3-(trifluoromethyl)phenyl]methanimine | N-oxido-1-[3-(trifluoromethyl)phenyl]methanimine | 188.13 |
| 52073 | C8H5F3NNaO | sodium N-oxido-1-[2-(trifluoromethyl)phenyl]methanimine | sodium N-oxido-1-[2-(trifluoromethyl)phenyl]methanimine | 211.12 |
| 52074 | C8H5F3NO- | N-oxido-1-[2-(trifluoromethyl)phenyl]methanimine | N-oxido-1-[2-(trifluoromethyl)phenyl]methanimine | 188.13 |
| 52075 | C8H5F3NNaO | sodium N-oxido-1-[4-(trifluoromethyl)phenyl]methanimine | sodium N-oxido-1-[4-(trifluoromethyl)phenyl]methanimine | 211.12 |
| 52076 | C8H5F3NO- | N-oxido-1-[4-(trifluoromethyl)phenyl]methanimine | N-oxido-1-[4-(trifluoromethyl)phenyl]methanimine | 188.13 |
| 52314 | C12H15FO | 1-(4-fluorophenyl)-1-(1-methylcyclopropyl)ethanol | 73728-62-8 | 194.24 |
| 52340 | C9H14AsF6N | benzyl(dimethyl)ammonium;hexafluoroarsenic(1-) | Benzyldimethylammonium hexafluoroarsenate | 325.13 |
| 52343 | C13H14F3NO3 | methyl 4-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]butanoate | 73747-24-7 | 289.25 |
| 52374 | C17H23F3N2O | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]-1-(1-piperidyl)ethanone | BRN 1263287 | 328.37 |
| 52408 | C14H18F3NO2 | 3-hydroxy-N-[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]butanamide | 73758-50-6 | 289.29 |
| 52525 | C18H26ClFN2 | 3-(2-fluoro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl)propyl-dimethyl-ammonium chloride | Cyclohept(b)indole, 5,6,7,8,9,10-hexahydro-10-(3-(dimethylamino)propyl)-2-fluoro-, hydrochloride | 324.9 |
| 52526 | C18H25FN2 | 3-(2-fluoro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl)-N,N-dimethyl-propan-1-amine | 3-(2-fluoro-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl)-N,N-dimethyl-propan-1-amine | 288.4 |
| 52667 | C20H30ClFN2O | 4-(3-azoniaspiro[5.5]undecan-3-yl)-1-(4-fluorophenyl)butan-1-one oxime chloride | 4-(3-azoniaspiro[5.5]undecan-3-yl)-1-(4-fluorophenyl)butan-1-one oxime chloride | 368.9 |
| 52668 | C20H29FN2O | 4-(3-azaspiro[5.5]undecan-3-yl)-1-(4-fluorophenyl)butan-1-one oxime | 4-(3-azaspiro[5.5]undecan-3-yl)-1-(4-fluorophenyl)butan-1-one oxime | 332.5 |
| 52709 | C14H18F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl acetate | BRN 2991889 | 289.29 |
| 52710 | C18H19F3N2O2 | 2-[2-[3-(trifluoromethyl)phenyl]ethylamino]ethyl 2-aminobenzoate | 2-[2-[3-(trifluoromethyl)phenyl]ethylamino]ethyl 2-aminobenzoate | 352.4 |
| 52711 | C19H21F3N2O2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-aminobenzoate | BRN 3008936 | 366.4 |
| 52712 | C14H17ClF3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-chloroacetate | BRN 2999620 | 323.74 |
| 52713 | C19H19ClF3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-chlorobenzoate | BRN 3009727 | 385.8 |
| 52714 | C19H19ClF3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-chlorobenzoate | BRN 3008938 | 385.8 |
| 52715 | C20H21ClF3NO3 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-(4-chlorophenoxy)acetate | BRN 3016634 | 415.8 |
| 52716 | C20H21ClF3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-(4-chlorophenyl)acetate | BRN 3012492 | 399.8 |
| 52717 | C16H20F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl cyclopropanecarboxylate | BRN 3001536 | 315.33 |
| 52718 | C23H26F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-cyclopropyl-2-phenyl-acetate | 73927-39-6 | 405.5 |
| 52719 | C19H19F4NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-fluorobenzoate | BRN 3008937 | 369.4 |
| 52720 | C19H20F3NO3 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-hydroxybenzoate | BRN 3009667 | 367.4 |
| 52721 | C23H28F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-isobutylbenzoate | 73927-42-1 | 407.5 |
| 52722 | C17H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-methylbut-2-enoate | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-methylbut-2-enoate | 329.36 |
| 52723 | C23H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl naphthalene-1-carboxylate | BRN 3012323 | 401.4 |
| 52724 | C23H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl naphthalene-2-carboxylate | BRN 3012905 | 401.4 |
| 52725 | C19H19F3N2O4 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-nitrobenzoate | 2-(alpha-Methyl-m-trifluoromethylphenethylamino)ethanol p-nitrobenzoate | 396.4 |
| 52726 | C20H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-phenylacetate | BRN 3007803 | 365.4 |
| 52727 | C22H26F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 2-phenylbutanoate | BRN 3014186 | 393.4 |
| 52728 | C21H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 3-phenylprop-2-enoate | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 3-phenylprop-2-enoate | 377.4 |
| 52729 | C15H20F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl propanoate | BRN 2997001 | 303.32 |
| 52730 | C20H22F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 4-methylbenzoate | BRN 3006342 | 365.4 |
| 52731 | C20H19F6NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 3-(trifluoromethyl)benzoate | BRN 3017970 | 419.4 |
| 52732 | C22H26F3NO5 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 3,4,5-trimethoxybenzoate | 73927-53-4 | 441.4 |
| 52743 | C13H7BF4N2O2 | 6-oxobenzo[c]chromene-1-diazonium tetrafluoroborate | NSC 81313 | 310.01 |
| 52782 | C21H24F3NO2 | 2-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethyl 3-phenylpropanoate | BRN 3039709 | 379.4 |
| 52804 | C13H20F3IN2 | trimethyl-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ammonium iodide | (alpha-Methyl-m-trifluoromethylphenethylamino)trimethylammonium iodide | 388.21 |
| 52805 | C13H20F3N2+ | trimethyl-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ammonium | trimethyl-[[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ammonium | 261.31 |
| 52820 | F3H5N2Sn | hydrazine;trifluorostannane | hydrazine;trifluorostannane | 208.76 |
| 52823 | C22H24FNO2 | 1-(4-fluorophenyl)-4-spiro[2H-benzofuran-3,4'-piperidine]-1'-yl-butan-1-one | BRN 5618218 | 353.4 |
| 52824 | C23H27ClFNO3 | 1-(4-fluorophenyl)-4-(7-methoxyspiro[2H-benzofuran-3,4'-piperidin-1-ium]-1'-yl)butan-1-one chloride | 73962-18-2 | 419.9 |
| 52825 | C23H26FNO3 | 1-(4-fluorophenyl)-4-(7-methoxyspiro[2H-benzofuran-3,4'-piperidine]-1'-yl)butan-1-one | 1-(4-fluorophenyl)-4-(7-methoxyspiro[2H-benzofuran-3,4'-piperidine]-1'-yl)butan-1-one | 383.5 |
| 52826 | C25H28FNO7 | 1-(4-fluorophenyl)-4-(2-methoxyspiro[2H-benzofuran-3,4'-piperidin-1-ium]-1'-yl)butan-1-one;2-hydroxy-2-oxo-acetate | 73962-22-8 | 473.5 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.