Fluorine Compounds (F)
Browse all compounds containing Fluorine by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
We're currently updating our database. We've sourced 10 million compounds so far, with the full 170 million coming shortly.
Total Compounds: 934,613
Showing 741,401 - 741,450 of 934,613
Page 14829 of 18,693
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 5324698 | C14H12F2O2 | (1R,2S)-1,2-bis(3-fluorophenyl)ethane-1,2-diol | (1R,2S)-1,2-bis(3-fluorophenyl)ethane-1,2-diol | 250.24 |
| 5324699 | C9H10F3N | N,N-dimethyl-3-(trifluoromethyl)aniline | N,N-dimethyl-3-(trifluoromethyl)aniline | 189.18 |
| 5324700 | C9H9F3O | 1-(methoxymethyl)-4-(trifluoromethyl)benzene | 1-(methoxymethyl)-4-(trifluoromethyl)benzene | 190.16 |
| 5324887 | C3HCl4F | 1,1,3,3-tetrachloro-3-fluoro-prop-1-ene | SCHEMBL1614733 | 197.8 |
| 5324890 | C5H2Cl3F3O2 | 2,2,2-trifluoroethyl 2,3,3-trichloroprop-2-enoate | InChI=1/C5H2Cl3F3O2/c6-2(3(7)8)4(12)13-1-5(9,10)11/h1H | 257.42 |
| 5324902 | C8H5Cl2F | 1-(2,2-dichlorovinyl)-4-fluoro-benzene | 1-(2,2-Dichlorovinyl)-4-fluorobenzene | 191.03 |
| 5324903 | C8H5Cl2F | 1-(2,2-dichlorovinyl)-3-fluoro-benzene | 1-(2,2-dichlorovinyl)-3-fluorobenzene | 191.03 |
| 5324947 | C3HBrF4O2 | (2R)-2-bromo-2,3,3,3-tetrafluoro-propanoic acid | (2R)-2-bromo-2,3,3,3-tetrafluoro-propanoic acid | 224.94 |
| 5324971 | C11H14F2O2Si | ethyl 3-[difluoro(phenyl)silyl]propanoate | InChI=1/C11H14F2O2Si/c1-2-15-11(14)8-9-16(12,13)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H | 244.31 |
| 5324982 | C9H10BrF | [(1R)-2-bromo-1-fluoro-1-methyl-ethyl]benzene | ((R,S)-2-Bromo-1-fluoro-1-methyl-ethyl)-benzene | 217.08 |
| 5325044 | C7H5FN2 | 3-fluoro-2H-indazole | 3-fluoro-1H-indazole | 136.13 |
| 5325077 | C31H23F2P | bis(4-fluorophenyl)methylene-triphenyl-lambda5-phosphane | InChI=1/C31H23F2P/c32-26-20-16-24(17-21-26)31(25-18-22-27(33)23-19-25)34(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-23 | 464.5 |
| 5325099 | C12H14F3NO2S | (4R)-4-isopropyl-2-[4-(trifluoromethyl)phenyl]-1-oxa-2lambda6-thia-3-azacyclopent-2-ene 2-oxide | (4R)-4-isopropyl-2-[4-(trifluoromethyl)phenyl]-1-oxa-2lambda6-thia-3-azacyclopent-2-ene 2-oxide | 293.31 |
| 5325100 | C6H14F3NO2SSi | trimethyl-[[methyl-oxo-(2,2,2-trifluoroethoxy)-lambda6-sulfanylidene]amino]silane | SCHEMBL9400199 | 249.33 |
| 5325102 | C11H16F3NO2SSi | trimethyl-[[oxo-phenyl-(2,2,2-trifluoroethoxy)-lambda6-sulfanylidene]amino]silane | SCHEMBL9456389 | 311.40 |
| 5325138 | C8H5F3O3 | (Z)-1,1,1-trifluoro-4-(2-furyl)-4-hydroxy-but-3-en-2-one | SCHEMBL25142175 | 206.12 |
| 5325182 | C3H3BrClFO | (1S)-1-bromo-1-chloro-1-fluoro-propan-2-one | (1S)-1-Brom-1-chlor-1-fluorpropan-2-on | 189.41 |
| 5325183 | C4H6ClFO | (3S)-3-chloro-3-fluoro-butan-2-one | (3S)-3-chloro-3-fluoro-butan-2-one | 124.54 |
| 5325184 | C4H3ClF2O3 | methyl 3-chloro-3,3-difluoro-2-oxo-propanoate | methyl 3-chloro-3,3-difluoropyruvate | 172.51 |
| 5325187 | C7H10ClF | (1R,6S)-7-chloro-7-fluoro-norcarane | 16646-93-8 | 148.60 |
| 5325198 | C4H3F3Se | 3-(trifluoromethylselanyl)prop-1-yne | InChI=1/C4H3F3Se/c1-2-3-8-4(5,6)7/h1H,3H | 187.03 |
| 5325199 | C4H3F3S | 3-(trifluoromethylsulfanyl)prop-1-yne | propargyl trifluoromethyl sulfide | 140.13 |
| 5325298 | C7H7FI+ | (3-fluorophenyl)-methyl-iodonium | InChI=1/C7H7FI/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3/q+ | 237.03 |
| 5325299 | C7H7FI+ | (2-fluorophenyl)-methyl-iodonium | InChI=1/C7H7FI/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3/q+ | 237.03 |
| 5325338 | C8H10F3NO2 | (E)-1,1,1-trifluoro-4-morpholino-but-3-en-2-one | (3E)-1,1,1-trifluoro-4-(morpholin-4-yl)but-3-en-2-one | 209.17 |
| 5325403 | C12H12F2N4O2S | N-(4,6-difluoro-1,3,5-triazin-2-yl)-N-ethyl-4-methyl-benzenesulfonamide | InChI=1/C12H12F2N4O2S/c1-3-18(12-16-10(13)15-11(14)17-12)21(19,20)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H | 314.31 |
| 5325484 | C17H17FO2S | 1-[(E)-3-benzyloxy-1-fluoro-prop-1-enyl]sulfinyl-4-methyl-benzene | 1-[(E)-3-benzyloxy-1-fluoro-prop-1-enyl]sulfinyl-4-methyl-benzene | 304.4 |
| 5325485 | C2H2ClFO | 2-chloroacetyl fluoride | chloroacetyl fluoride | 96.49 |
| 5325486 | C2H2BrFO | 2-bromoacetyl fluoride | bromoacetyl fluoride | 140.94 |
| 5325487 | C5H8F2O | 3-fluoro-2,2-dimethyl-propanoyl fluoride | SCHEMBL1054318 | 122.11 |
| 5325488 | C3HFO | prop-2-ynoyl fluoride | Prop-2-ynoyl Fluoride | 72.04 |
| 5325489 | C4H3FO | but-2-ynoyl fluoride | 2-Butynoyl fluoride | 86.06 |
| 5325490 | C9H5FO | 3-phenylprop-2-ynoyl fluoride | 3-phenylpropynoyl fluoride | 148.13 |
| 5325491 | C15H22FNO3 | 2-[benzyl(2,2-diethoxyethyl)amino]acetyl fluoride | InChI=1/C15H22FNO3/c1-3-19-15(20-4-2)12-17(11-14(16)18)10-13-8-6-5-7-9-13/h5-9,15H,3-4,10-12H2,1-2H | 283.34 |
| 5325492 | C8H7FO | 3-methylbenzoyl fluoride | 3-methylbenzoyl Fluoride | 138.14 |
| 5325493 | C15H21FO | (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienoyl fluoride | InChI=1/C15H21FO/c1-11(10-14(16)17)7-8-13-12(2)6-5-9-15(13,3)4/h7-8,10H,5-6,9H2,1-4H3/b8-7+,11-10 | 236.32 |
| 5325496 | C2BrF3O | 2,2,2-trifluoroacetyl bromide | trifluoroacetyl bromide | 176.92 |
| 5325531 | C8H7Br3F6O2 | (E)-1,1,1-tribromo-4,4-bis(2,2,2-trifluoroethoxy)but-2-ene | InChI=1/C8H7Br3F6O2/c9-6(10,11)2-1-5(18-3-7(12,13)14)19-4-8(15,16)17/h1-2,5H,3-4H2/b2-1 | 488.84 |
| 5325549 | C8H5F3O3 | 2-methoxy-5-(trifluoromethyl)-1,4-benzoquinone | 2-Methoxy-5-(trifluoromethyl)-1,4-benzoquinone | 206.12 |
| 5325648 | C7H7FSe | 1-fluoro-4-methylselanyl-benzene | 1-fluoro-4-methylselanylbenzene | 189.10 |
| 5325675 | C16H15FN2O3S | (4R)-4-(4-fluorophenyl)-5-methylsulfonyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one | (4R)-4-(4-fluorophenyl)-5-methylsulfonyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one | 334.4 |
| 5325696 | C14H10FN7O3 | (4R)-2-amino-4-(4-fluorophenyl)-6-methyl-5-(5-nitrotetrazol-2-yl)-4H-pyran-3-carbonitrile | (4R)-2-amino-4-(4-fluorophenyl)-6-methyl-5-(5-nitrotetrazol-2-yl)-4H-pyran-3-carbonitrile | 343.27 |
| 5325848 | C18H11BrF4O2 | 2-[(4-bromophenyl)methoxy]-5-(4-fluorophenyl)-3-(trifluoromethyl)furan | InChI=1/C18H11BrF4O2/c19-13-5-1-11(2-6-13)10-24-17-15(18(21,22)23)9-16(25-17)12-3-7-14(20)8-4-12/h1-9H,10H | 415.2 |
| 5325861 | C6H10BrF | trans-(1R,2R)-1-bromo-2-fluoro-cyclohexane | 17170-96-6 | 181.05 |
| 5325966 | C17H14F6S2 | 2-[2-(3,5-dimethyl-2-thienyl)-3,3,4,4,5,5-hexafluoro-cyclopenten-1-yl]-3,5-dimethyl-thiophene | 1,2-bis(3,5-dimethyl-2-thienyl)perfluorocyclopentene | 396.4 |
| 5326027 | C13H15FO2 | 4-(4-fluorophenyl)cyclohexanecarboxylic acid | 91161-90-9 | 222.25 |
| 5326061 | C23H15F7O | 5-(4-but-3-enylphenyl)-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-benzene | SCHEMBL13671383 | 440.4 |
| 5326071 | C16H15FO2S | 1-fluoro-4-[(E)-2-(4-methylsulfonylphenyl)prop-1-enyl]benzene | InChI=1/C16H15FO2S/c1-12(11-13-3-7-15(17)8-4-13)14-5-9-16(10-6-14)20(2,18)19/h3-11H,1-2H3/b12-11 | 290.4 |
| 5326093 | C6H13BF2 | difluoro(hexyl)borane | difluoro(hexyl)borane | 133.98 |
| 5326116 | C3H9BFN | N-[fluoro(methyl)boranyl]-N-methyl-methanamine | SCHEMBL21562233 | 88.92 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.