Chlorine + Oxygen Compounds (Cl + O)
Browse all compounds containing Chlorine + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
We're currently updating our database. We've sourced 10 million compounds so far, with the full 170 million coming shortly.
Total Compounds: 1,479,729
Showing 13,201 - 13,250 of 1,479,729
Page 265 of 29,595
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 76010 | C12H10ClNO | 2-(4-chlorophenoxy)aniline | 2-(4-Chlorophenoxy)aniline | 219.66 |
| 76011 | C10H13ClN4O2 | 7-(3-chloropropyl)-1,3-dimethyl-purine-2,6-dione | 7-(3-Chloropropyl)theophylline | 256.69 |
| 76017 | C9H11Cl2O2PS3 | (3,4-dichlorophenyl)sulfanylmethylsulfanyl-dimethoxy-thioxo-lambda5-phosphane | Geigy G-30493 | 349.3 |
| 76018 | C4H2Cl2N2O | 3,6-dichloro-1H-pyridazin-4-one | 3,6-Dichloropyridazin-4-ol | 164.97 |
| 76033 | C25H20ClN3O2 | 4-(5-chloro-2-methyl-phenyl)azo-3-hydroxy-N-(o-tolyl)naphthalene-2-carboxamide | EINECS 220-510-9 | 429.9 |
| 76036 | C7H5Cl2NO2 | 2-amino-3,5-dichloro-benzoic acid | 2-Amino-3,5-dichlorobenzoic acid | 206.02 |
| 76071 | C14H6Cl2O4 | 1,4-dichloro-5,8-dihydroxy-anthracene-9,10-dione | 1,4-Dichloro-5,8-dihydroxyanthraquinone | 309.1 |
| 76074 | C4Cl2F4O3 | (2-chloro-2,2-difluoro-acetyl) 2-chloro-2,2-difluoro-acetate | Chlorodifluoroacetic anhydride | 242.94 |
| 76085 | C15H10Cl2FNO2 | 2-chloro-N-[4-chloro-2-(2-fluorobenzoyl)phenyl]acetamide | 2836-40-0 | 326.1 |
| 76087 | C9H6Cl2F3NO | 2,2-dichloro-N-[3-(trifluoromethyl)phenyl]acetamide | 2837-61-8 | 272.05 |
| 76091 | C4H6ClNO2 | 1-chloro-3-nitroso-but-2-en-2-ol | 1-chloro-3-nitroso-but-2-en-2-ol | 135.55 |
| 76092 | C7H6ClNO2 | 3-amino-4-chloro-benzoic acid | 3-Amino-4-chlorobenzoic acid | 171.58 |
| 76099 | C16H13BrClNO2 | N-(2-benzoyl-4-chloro-phenyl)-2-bromo-N-methyl-acetamide | N-(2-Benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide | 366.63 |
| 76117 | C10H13Cl3NO3P | N-[ethoxy-(2,4,5-trichlorophenoxy)phosphoryl]ethanamine | 2864-61-1 | 332.5 |
| 76128 | C11H14ClNOSe | 3-ethyl-5-methoxy-2-methyl-1,3-benzoselenazol-3-ium chloride | 3-ethyl-5-methoxy-2-methyl-1,3-benzoselenazol-3-ium;chloride | 290.66 |
| 76145 | C8H9Cl2N3O5S2 | 2-chloro-N-(5-chloro-2,4-disulfamoyl-phenyl)acetamide | 2,5'-Dichloro-2',4'-disulphamoylacetanilide | 362.2 |
| 76160 | C15H12Cl2N2O2 | 2-chloro-N-[4-chloro-2-(N-hydroxy-C-phenyl-carbonimidoyl)phenyl]acetamide | 2888-63-3 | 323.2 |
| 76161 | C6H3Cl3O4S2 | 4-chlorobenzene-1,3-disulfonyl chloride | 2891-17-0 | 309.6 |
| 76165 | C13H10ClNO | (2-aminophenyl)-(2-chlorophenyl)methanone | 2894-45-3 | 231.68 |
| 76166 | C13H10ClNO | (2-aminophenyl)-(4-chlorophenyl)methanone | 2-Amino-4'-chlorobenzophenone | 231.68 |
| 76168 | C16H12Cl2N2O | 7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one | 2-Chlorodiazepam | 319.2 |
| 76171 | C5H10ClNO | 2-chloro-N-isopropyl-acetamide | 2895-21-8 | 135.59 |
| 76176 | C13H4Cl8N2O | 1,3-dichloro-1,3-bis(2,4,6-trichlorophenyl)urea | n,n'-dichlorobis(2,4,6-trichlorophenyl)urea | 487.8 |
| 76182 | C13H12ClNO2S | N-(4-chlorophenyl)-4-methyl-benzenesulfonamide | N-(4-Chlorophenyl)-4-methylbenzenesulfonamide | 281.76 |
| 76183 | C19H19Cl2N3O4 | N-(4-chloro-2,5-dimethoxy-phenyl)-2-(4-chloro-2-methyl-phenyl)azo-3-oxo-butanamide | EINECS 220-802-6 | 424.3 |
| 76185 | C7H3Cl2NO | 2,6-dichlorobenzonitrile oxide | 2,6-dichlorobenzonitrile oxide | 188.01 |
| 76187 | C6H4Cl2O2S | 2-chlorobenzenesulfonyl chloride | 2-Chlorobenzenesulfonyl chloride | 211.06 |
| 76189 | C8H6Cl2O2 | methyl 2,3-dichlorobenzoate | Methyl 2,3-dichlorobenzoate | 205.03 |
| 76191 | C7H3Cl3O | 3,5-dichlorobenzoyl chloride | 3,5-Dichlorobenzoyl chloride | 209.5 |
| 76192 | C8H6Cl2O2 | methyl 3,5-dichlorobenzoate | Methyl 3,5-dichlorobenzoate | 205.03 |
| 76193 | C8H6Cl2O2 | methyl 3,4-dichlorobenzoate | 2905-68-2 | 205.03 |
| 76206 | C5H7ClO2 | allyl 2-chloroacetate | Allyl chloroacetate | 134.56 |
| 76207 | C8H12Cl2O4 | 6-chlorocarbonyloxyhexyl carbonochloridate | Hexamethylene bis(chloroformate) | 243.08 |
| 76208 | C10H14Cl2O4 | [4-(chlorocarbonyloxymethyl)cyclohexyl]methyl carbonochloridate | 1,4-Cyclohexanebis(methylene chloroformate) | 269.12 |
| 76211 | C9H11ClNO4PS | (2-chloro-4-nitro-phenoxy)-ethyl-methoxy-thioxo-lambda5-phosphane | O-(2-Chloro-4-nitrophenyl) O-methyl ethylphosphonothioate | 295.68 |
| 76220 | C2AgClF2O2 | silver 2-chloro-2,2-difluoro-acetate | Acetic acid, 2-chloro-2,2-difluoro-, silver(1+) salt (1:1) | 237.34 |
| 76240 | C8H15ClO | 2-propylpentanoyl chloride | 2-Propylvaleryl chloride | 162.66 |
| 76258 | C6H4ClNO2 | 2-chloropyridine-3-carboxylic acid | 2-Chloronicotinic acid | 157.55 |
| 76259 | C5H15ClOSi2 | chloro-dimethyl-trimethylsilyloxy-silane | Disiloxane, chloropentamethyl- | 182.79 |
| 76260 | C6H14Cl4OSi2 | dichloromethyl-[dichloromethyl(dimethyl)silyl]oxy-dimethyl-silane | 2943-70-6 | 300.2 |
| 76270 | C13H9ClO3 | (4-chlorophenyl) 2-hydroxybenzoate | 4-Chlorophenyl salicylate | 248.66 |
| 76286 | C9H12ClO3PS2 | (3-chloro-4-methylsulfanyl-phenoxy)-dimethoxy-thioxo-lambda5-phosphane | Bayer 29491 | 298.7 |
| 76287 | C15H10Cl2N2O2 | 7-chloro-5-(2-chlorophenyl)-4-hydroxy-3H-1,4-benzodiazepin-2-one | 2955-37-5 | 321.2 |
| 76297 | C9H20ClNO2 | 2-butanoyloxyethyl(trimethyl)ammonium chloride | Butyrylcholine chloride | 209.71 |
| 76298 | C12H18ClNO2 | 2-benzoyloxyethyl(trimethyl)ammonium chloride | Benzoylcholine chloride | 243.73 |
| 76302 | C14H11Cl3O2 | 4-[2,2,2-trichloro-1-(4-hydroxyphenyl)ethyl]phenol | Hydroxychlor | 317.6 |
| 76305 | C7H6ClNO3 | 2-(chloromethyl)-4-nitro-phenol | 2-(Chloromethyl)-4-nitrophenol | 187.58 |
| 76315 | C8H12ClNO2 | 4-amino-2-methoxy-6-methyl-phenol;hydrochloride | 2977-70-0 | 189.64 |
| 76346 | C5H8Cl3NO | N,N-bis(2-chloroethyl)carbamoyl chloride | Bis(2-chloroethyl)carbamoyl chloride | 204.48 |
| 76369 | C11H14ClNO2 | N-butyl-3-chloro-2-hydroxy-benzamide | 3009-04-9 | 227.69 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.