Chlorine + Oxygen Compounds (Cl + O)
Browse all compounds containing Chlorine + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 51921 | C12H13Cl2N3O3 | N-[4-acetamido-3-[(2-chloroacetyl)amino]phenyl]-2-chloro-acetamide | ACETANILIDE, 2',4'-BIS(2-CHLOROACETAMIDO)- | 318.15 |
| 51924 | C9H10Cl2N2O | N-(2,6-dichlorophenyl)-2-(methylamino)acetamide | 73623-37-7 | 233.09 |
| 51925 | C12H14Cl2N2O | N-(2,6-dichlorophenyl)-2-pyrrolidin-2-yl-acetamide | 73623-38-8 | 273.15 |
| 51927 | C8H5Cl3INO | 2-iodo-N-(2,4,6-trichlorophenyl)acetamide | 2-Iodo-2',4',6'-trichloroacetanilide | 364.4 |
| 51928 | C13H20ClNO2 | [4-(2-isopentyloxy-2-oxo-ethyl)phenyl]ammonium chloride | 73623-41-3 | 257.75 |
| 51930 | C13H20ClNO2 | [2-(1-ethylpropoxy)-2-oxo-1-phenyl-ethyl]ammonium chloride | 73623-42-4 | 257.75 |
| 51933 | C5H9ClO2S | methyl 2-(2-chloroethylsulfanyl)acetate | Methyl 2-chloroethylthioacetate | 168.64 |
| 51934 | C12H9ClO3 | 2-[(2-chloro-1-naphthyl)oxy]acetic acid | 73623-45-7 | 236.65 |
| 51936 | C27H50ClNO3S | 4-chlorobenzenesulfonate;trimethyl(octadecyl)ammonium | AMMONIUM, OCTADECYLTRIMETHYL-, p-CHLOROPHENYLSULFONATE | 504.2 |
| 51938 | C30H46Cl4N4O2 | (4-chlorophenyl)methyl-[3-[[2-[3-[(4-chlorophenyl)methyl-diethyl-ammonio]propylamino]-2-oxo-acetyl]amino]propyl]-diethyl-ammonium dichloride | Ammonium, bicarbamoylditrimethylenebis((p-chlorobenzyl)diethyl-, dichloride | 636.5 |
| 51939 | C30H46Cl2N4O2+2 | (4-chlorophenyl)methyl-[3-[[2-[3-[(4-chlorophenyl)methyl-diethyl-ammonio]propylamino]-2-oxo-acetyl]amino]propyl]-diethyl-ammonium | (4-chlorophenyl)methyl-[3-[[2-[3-[(4-chlorophenyl)methyl-diethyl-ammonio]propylamino]-2-oxo-acetyl]amino]propyl]-diethyl-ammonium | 565.6 |
| 51949 | C18H42Cl3N3O3 | 2-[4,6-bis[2-(trimethylammonio)ethyl]-1,3,5-trioxan-2-yl]ethyl-trimethyl-ammonium trichloride | 73637-03-3 | 454.9 |
| 51953 | C21H17Cl2NO2S | 2-chloro-N-(4-methylsulfonylphenyl)-2,2-diphenyl-acetimidoyl chloride | N-(1,2-Dichloro-2,2-diphenylethylidene)-4-(methylsulfonyl)aniline | 418.3 |
| 51954 | C20H14Cl2N2O2 | 2-chloro-N-(4-nitrophenyl)-2,2-diphenyl-acetimidoyl chloride | 73637-07-7 | 385.2 |
| 51956 | C6H2Cl3NOS | 1,2,4-trichloro-5-(sulfinylamino)benzene | N-Sulfinyl-2,4,5-trichloroaniline | 242.5 |
| 51957 | C9H9ClO2 | 2-(chloromethyl)-4-methoxy-benzaldehyde | o-Chloromethylanisaldehyde | 184.62 |
| 51966 | C5H11ClO2Si | 4-(chloromethyl)-2,2-dimethyl-1,3,2-dioxasilolane | 73639-62-0 | 166.68 |
| 51969 | C13H9ClN2O3 | 1-(4-chloro-2-nitro-phenyl)-N-phenyl-methanimine oxide | 1-(4-chloro-2-nitro-phenyl)-N-phenyl-methanimine oxide | 276.67 |
| 51970 | C13H11ClN2O2S | N-[(4-chlorophenyl)sulfanylmethyl]-3-nitro-aniline | 73651-48-6 | 294.76 |
| 51979 | C15H15ClN2O | [4-[cyano-(4-methoxyphenyl)methyl]phenyl]ammonium chloride | EINECS 277-563-6 | 274.74 |
| 51989 | C26H26ClN3O3 | 4-[(6-chloro-10-hydroxy-2-methoxy-acridin-9-ylidene)amino]-2-(1-piperidylmethyl)phenol | 73663-84-0 | 464.0 |
| 52005 | C11H17BrClNO2S | 2-(4-chlorophenyl)sulfonylethyl-trimethyl-ammonium bromide | 2-(p-Chlorophenylsulfonyl)ethyltrimethylammonium bromide | 342.68 |
| 52006 | C11H17ClNO2S+ | 2-(4-chlorophenyl)sulfonylethyl-trimethyl-ammonium | 2-(4-chlorophenyl)sulfonylethyl-trimethyl-ammonium | 262.78 |
| 52007 | C13H21ClIN3O | 3-[(4-chlorophenyl)carbamoylamino]propyl-trimethyl-ammonium iodide | NSC 196189 | 397.68 |
| 52008 | C13H21ClN3O+ | 3-[(4-chlorophenyl)carbamoylamino]propyl-trimethyl-ammonium | 3-[(4-chlorophenyl)carbamoylamino]propyl-trimethyl-ammonium | 270.78 |
| 52011 | C13H19Cl2IN2O | [2-(3,4-dichloroanilino)-2-oxo-ethyl]-diethyl-methyl-ammonium iodide | (3,4-Dichlorophenylcarbamoylmethyl)diethylmethylammonium iodide | 417.11 |
| 52012 | C13H19Cl2N2O+ | [2-(3,4-dichloroanilino)-2-oxo-ethyl]-diethyl-methyl-ammonium | CHEMBL555069 | 290.21 |
| 52021 | C26H32ClNO | diethyl-(3-hydroxy-1,3,3-triphenyl-propyl)-methyl-ammonium chloride | 73664-08-1 | 410.0 |
| 52046 | C15H9ClF3NO | N-(1-chloro-9H-fluoren-2-yl)-2,2,2-trifluoro-acetamide | ACETAMIDE, N-(CHLOROFLUOREN-2-YL)-2,2,2-TRIFLUORO- | 311.68 |
| 52047 | C18H12ClNO | N-(2-chlorofluoranthen-3-yl)acetamide | N-(2-chlorofluoranthen-3-yl)acetamide | 293.7 |
| 52048 | C9H11ClN2O | 2-chloro-N-[2-(2-pyridyl)ethyl]acetamide | 73664-37-6 | 198.65 |
| 52049 | C15H11Cl2NO | N-(2,7-dichloro-9H-fluoren-4-yl)acetamide | N-(2,7-Dichlorofluoren-4-yl)acetamide | 292.2 |
| 52061 | C9H11ClN2O | 2-chloro-4-(dimethylamino)benzaldehyde oxime | SCHEMBL28728366 | 198.65 |
| 52063 | C21H32ClN7O3 | diethyl-[2-[4-[[(1,3,7-trimethyl-2,6-dioxo-4,5-dihydropurin-8-yl)hydrazono]methyl]phenoxy]ethyl]ammonium chloride | diethyl-[2-[4-[[(1,3,7-trimethyl-2,6-dioxo-4,5-dihydropurin-8-yl)hydrazono]methyl]phenoxy]ethyl]ammonium chloride | 466.0 |
| 52068 | C7H3Cl3O2 | 2,4,6-trichloro-3-hydroxy-benzaldehyde | 2,4,6-Trichloro-3-hydroxybenzaldehyde | 225.5 |
| 52069 | C7H4Cl3NO2 | 2,4,6-trichloro-3-hydroxy-benzaldehyde oxime | 2,4,6-trichloro-3-hydroxy-benzaldehyde oxime | 240.5 |
| 52090 | C9H6Cl5NO2 | 3,4-dichloro-N-(2,2,2-trichloro-1-hydroxy-ethyl)benzamide | 73664-77-4 | 337.4 |
| 52091 | C14H23ClN2O4 | dimethyl-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]ammonium chloride | N-(beta-Dimethylaminoethyl)-3,4,5-trimethoxybenzamide hydrochloride | 318.79 |
| 52100 | C29H36Cl3N3O2 | [4-[(6-chloro-2-methoxy-acridin-9-yl)ammonio]-4-(4-methoxyphenyl)butyl]-diethyl-ammonium dichloride | 73680-44-1 | 565.0 |
| 52101 | C29H34ClN3O2 | N-(6-chloro-2-methoxy-acridin-9-yl)-N',N'-diethyl-1-(4-methoxyphenyl)butane-1,4-diamine | N-(6-chloro-2-methoxy-acridin-9-yl)-N',N'-diethyl-1-(4-methoxyphenyl)butane-1,4-diamine | 492.0 |
| 52104 | C18H18Cl2N2O2 | N,N'-bis(3-chlorophenyl)hexanediamide | 73680-49-6 | 365.2 |
| 52108 | C14H18Cl2N4O2 | 2-amino-2-[6-[bis(2-chloroethyl)amino]-1H-benzimidazol-2-yl]propanoic acid | 2-(5-(Bis-(2-chloroethyl)amino)-2-benzimidazolyl)alanine | 345.2 |
| 52109 | C15H20Cl2N4O2 | 2-amino-2-[5-[bis(2-chloroethyl)amino]-1-methyl-benzimidazol-2-yl]propanoic acid | 73680-55-4 | 359.2 |
| 52118 | C36H54Cl2N4O4 | 3-[[4-[3-[diethyl-[(2-methoxyphenyl)methyl]ammonio]propylamino]-3,6-dioxo-cyclohexa-1,4-dien-1-yl]amino]propyl-diethyl-[(2-methoxyphenyl)methyl]ammonium dichloride | Ammonium, (p-benzoquinon-2,5-ylenebis(iminotrimethylene))bis(diethyl(o-methoxybenzyl)-, dichloride | 677.7 |
| 52124 | C22H36ClNO2 | (2-heptoxy-2-oxo-ethyl)-dimethyl-(3-methyl-4-phenyl-but-2-enyl)ammonium chloride | (2-heptoxy-2-oxo-ethyl)-dimethyl-(3-methyl-4-phenyl-but-2-enyl)ammonium chloride | 382.0 |
| 52128 | C20H25Cl2NO2 | benzyl(triethyl)ammonium;2,4-dichlorobenzoate | Benzyltriethylammonium 2,4-dichlorobenzoate | 382.3 |
| 52129 | C21H27Cl2NO3 | benzyl(triethyl)ammonium;2-(2,4-dichlorophenoxy)acetate | NSC 221292 | 412.3 |
| 52130 | C19H22Cl5NO | benzyl(triethyl)ammonium;2,3,4,5,6-pentachlorophenolate | DTXSID80994514 | 457.6 |
| 52131 | C19H24Cl3NO | benzyl(triethyl)ammonium;2,4,5-trichlorophenolate | Benzyltriethylammonium 2,4,5-trichlorophenate | 388.8 |
| 52132 | C21H26Cl3NO3 | benzyl(triethyl)ammonium;2-(2,4,5-trichlorophenoxy)acetate | AMMONIUM, BENZYLTRIETHYL-, 2,4,5-TRICHLOROPHENOXYACETATE | 446.8 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.