Carbon + Oxygen Compounds (C + O)
Browse all compounds containing Carbon + Oxygen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
We're currently updating our database. We've sourced 10 million compounds so far, with the full 170 million coming shortly.
Total Compounds: 6,571,471
Showing 60,301 - 60,350 of 6,571,471
Page 1207 of 131,430
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 76197 | C27H20N2O5S | N-(4-amino-9,10-dioxo-3-phenoxy-1-anthryl)-4-methyl-benzenesulfonamide | 2907-79-1 | 484.5 |
| 76201 | C10H7NO3 | 2-(1,3-dioxoisoindolin-2-yl)acetaldehyde | 2913-97-5 | 189.17 |
| 76204 | C19H30O2 | dodecyl benzoate | Dodecyl benzoate | 290.4 |
| 76206 | C5H7ClO2 | allyl 2-chloroacetate | Allyl chloroacetate | 134.56 |
| 76207 | C8H12Cl2O4 | 6-chlorocarbonyloxyhexyl carbonochloridate | Hexamethylene bis(chloroformate) | 243.08 |
| 76208 | C10H14Cl2O4 | [4-(chlorocarbonyloxymethyl)cyclohexyl]methyl carbonochloridate | 1,4-Cyclohexanebis(methylene chloroformate) | 269.12 |
| 76209 | C5H10O2 | 2,2-dimethyl-1,3-dioxolane | 2,2-Dimethyl-1,3-dioxolane | 102.13 |
| 76210 | C6H14O2Si | methyl 2-trimethylsilylacetate | 2916-76-9 | 146.26 |
| 76211 | C9H11ClNO4PS | (2-chloro-4-nitro-phenoxy)-ethyl-methoxy-thioxo-lambda5-phosphane | O-(2-Chloro-4-nitrophenyl) O-methyl ethylphosphonothioate | 295.68 |
| 76213 | C6H16OSi | 3-trimethylsilylpropan-1-ol | 3-(Trimethylsilyl)-1-propanol | 132.28 |
| 76214 | C6H14O2Si | trimethylsilylmethyl acetate | 2917-65-9 | 146.26 |
| 76215 | C10H17NO | N-cyclohexyl-2-methyl-prop-2-enamide | N-Cyclohexylmethacrylamide | 167.25 |
| 76216 | C12H10N2O6S | 3-(2,4-dihydroxyphenyl)azo-4-hydroxy-benzenesulfonic acid | EINECS 220-855-5 | 310.28 |
| 76217 | C5H6O | pent-4-en-2-yn-1-ol | Pent-4-en-2-yn-1-ol | 82.10 |
| 76218 | C4H8O | cyclobutanol | Cyclobutanol | 72.11 |
| 76220 | C2AgClF2O2 | silver 2-chloro-2,2-difluoro-acetate | Acetic acid, 2-chloro-2,2-difluoro-, silver(1+) salt (1:1) | 237.34 |
| 76221 | C2F3NaO2 | sodium 2,2,2-trifluoroacetate | sodium 2,2,2-trifluoroacetate | 136.00 |
| 76222 | C6F11NaO2 | sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate | sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate | 336.03 |
| 76223 | CAgF3O3S | silver trifluoromethanesulfonate | Silver trifluoromethanesulfonate | 256.94 |
| 76226 | C7H4FNO3 | 4-fluoro-2-nitro-benzaldehyde | 4-Fluoro-2-nitrobenzaldehyde | 169.11 |
| 76229 | C13H12O | (2-phenylphenyl)methanol | 2928-43-0 | 184.23 |
| 76230 | C11H9NO4 | 8-methoxy-4-oxo-1H-quinoline-2-carboxylic acid | 2929-14-8 | 219.19 |
| 76232 | C23H41BO3 | dibutyl (2,6-ditert-butyl-4-methyl-phenyl) borate | 2929-85-3 | 376.4 |
| 76233 | C30H63O3P | tris-decyl phosphite | Tridecyl phosphite | 502.8 |
| 76234 | C11H11NO6 | [acetoxy-(4-nitrophenyl)methyl] acetate | 2929-91-1 | 253.21 |
| 76235 | C12H28O4P2S4Zn | zinc bis(diisopropoxy-sulfido-thioxo-lambda5-phosphane) | Zinc tetraisopropyl bis(dithiophosphate) | 491.9 |
| 76236 | C11H14O | 1-(4-propylphenyl)ethanone | 1-(4-Propylphenyl)ethan-1-one | 162.23 |
| 76237 | C12H13NO | 2-(1-naphthylamino)ethanol | 2933-59-7 | 187.24 |
| 76238 | C9H13NO2 | 2-(2-methoxyanilino)ethanol | 2933-75-7 | 167.20 |
| 76239 | C10H12O3 | 2-(2,3-dimethylphenoxy)acetic acid | 2,3-Xylyloxyacetic acid | 180.20 |
| 76240 | C8H15ClO | 2-propylpentanoyl chloride | 2-Propylvaleryl chloride | 162.66 |
| 76241 | C14H18O | cyclohexyl(o-tolyl)methanone | 2936-55-2 | 202.29 |
| 76242 | C2H7NO3S2 | 1-amino-2-sulfosulfanyl-ethane | 2937-53-3 | 157.22 |
| 76243 | C2H7NO2S2 | 2-sulfanylsulfonylethanamine | 2-sulfanylsulfonylethanamine | 141.22 |
| 76244 | C8H10O3 | 2,6-bis(hydroxymethyl)phenol | 2,6-bis(hydroxymethyl)phenol | 154.16 |
| 76245 | C8H10O3 | 2,4-bis(hydroxymethyl)phenol | 2937-60-2 | 154.16 |
| 76246 | C9H12O4 | 2,4,6-tris(hydroxymethyl)phenol | 2937-61-3 | 184.19 |
| 76247 | C7H10O3 | 3,3-dimethyltetrahydropyran-2,6-dione | 2H-Pyran-2,6(3H)-dione, dihydro-3,3-dimethyl- | 142.15 |
| 76248 | C9H15NO | 4-ethyl-4-formyl-hexanenitrile | 4-Ethyl-4-formylhexanenitrile | 153.22 |
| 76249 | C19H23NO | 2-[3-(methylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol | 2939-66-4 | 281.4 |
| 76250 | C8H6N2O2S | 2-methyl-6-nitro-1,3-benzothiazole | 2-Methyl-6-nitrobenzothiazole | 194.21 |
| 76251 | C8H6N2O2S | 2-methyl-5-nitro-1,3-benzothiazole | 2941-66-4 | 194.21 |
| 76252 | C9H9NOS | 5-methoxy-2-methyl-1,3-benzothiazole | 5-Methoxy-2-methylbenzothiazole | 179.24 |
| 76254 | C9H9NOS | 6-methoxy-2-methyl-1,3-benzothiazole | 2941-72-2 | 179.24 |
| 76255 | C8H9NO2 | 2-amino-5-methyl-benzoic acid | 2-Amino-5-methylbenzoic acid | 151.16 |
| 76256 | C7H4N2O2S | 6-nitro-1,3-benzothiazole | 6-Nitrobenzothiazole | 180.19 |
| 76257 | C5H10NO3P | diethoxyphosphorylformonitrile | Diethyl cyanophosphonate | 163.11 |
| 76258 | C6H4ClNO2 | 2-chloropyridine-3-carboxylic acid | 2-Chloronicotinic acid | 157.55 |
| 76259 | C5H15ClOSi2 | chloro-dimethyl-trimethylsilyloxy-silane | Disiloxane, chloropentamethyl- | 182.79 |
| 76260 | C6H14Cl4OSi2 | dichloromethyl-[dichloromethyl(dimethyl)silyl]oxy-dimethyl-silane | 2943-70-6 | 300.2 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
NIH
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.