Carbon + Nitrogen Compounds (C + N)
Browse all compounds containing Carbon + Nitrogen by molecular formula, IUPAC name, or traditional name. Explore molecular weights and compound details.
| CID | Formula | IUPAC Name | Traditional Name | Mol. Weight |
|---|---|---|---|---|
| 16735 | C12H16FNO3 | 2-(dimethylamino)ethyl 2-(4-fluorophenoxy)acetate | STL300390 | 241.26 |
| 16736 | C8H6F3N3 | 5-(trifluoromethyl)-1H-indazol-3-amine | 5-(Trifluoromethyl)-1H-indazol-3-amine | 201.15 |
| 16738 | C9H12NO6P | dimethyl (3-methyl-4-nitro-phenyl) phosphate | Fenitrooxone | 261.17 |
| 16739 | C28H32ClFN2O6 | 4-[4-(3-chlorophenyl)-4-(pyrrolidin-1-ium-1-carbonyl)piperidin-1-ium-1-yl]-4-fluoro-1-phenyl-butan-1-one;oxalate | Haloperidide oxalate | 547.0 |
| 16740 | C26H30ClFN2O2 | 4-[4-(3-chlorophenyl)-4-(pyrrolidine-1-carbonyl)-1-piperidyl]-4-fluoro-1-phenyl-butan-1-one | 4-[4-(3-chlorophenyl)-4-(pyrrolidine-1-carbonyl)-1-piperidyl]-4-fluoro-1-phenyl-butan-1-one | 457.0 |
| 16741 | C9H9NS | 2-isothiocyanatoethylbenzene | 2-Phenylethyl isothiocyanate | 163.24 |
| 16743 | C28H42Br4N4O2 | (2-bromophenyl)methyl-[2-[[2-[2-[(2-bromophenyl)methyl-diethyl-ammonio]ethylamino]-2-oxo-acetyl]amino]ethyl]-diethyl-ammonium dibromide | (Oxalylbis(iminoethylene))bis((o-bromobenzyl)diethylammonium bromide) | 786.3 |
| 16744 | C28H42Br2N4O2+2 | (2-bromophenyl)methyl-[2-[[2-[2-[(2-bromophenyl)methyl-diethyl-ammonio]ethylamino]-2-oxo-acetyl]amino]ethyl]-diethyl-ammonium | BROMODECHLOROAMBENONIUM DIBROMIDE | 626.5 |
| 16745 | C22H42Br2N4O2 | 3-[[4-[3-[diethyl(methyl)ammonio]propylamino]-3,6-dioxo-cyclohexa-1,4-dien-1-yl]amino]propyl-diethyl-methyl-ammonium dibromide | Ammonium, (p-benzoquinon-2,5-ylenebis(iminotrimethylene))bis(diethylmethyl-, dibromide | 554.4 |
| 16746 | C22H42N4O2+2 | 3-[[4-[3-[diethyl(methyl)ammonio]propylamino]-3,6-dioxo-cyclohexa-1,4-dien-1-yl]amino]propyl-diethyl-methyl-ammonium | 3-[[4-[3-[diethyl(methyl)ammonio]propylamino]-3,6-dioxo-cyclohexa-1,4-dien-1-yl]amino]propyl-diethyl-methyl-ammonium | 394.6 |
| 16749 | C21H31NO3 | ethyl 4-phenyl-1-(3-tetrahydrofuran-2-ylpropyl)piperidine-4-carboxylate | 2260-45-9 | 345.5 |
| 16750 | C22H33NO3 | ethyl 4-phenyl-1-(4-tetrahydrofuran-2-ylbutyl)piperidine-4-carboxylate | DTXSID90945259 | 359.5 |
| 16751 | C11H8F3NO | 1-methyl-6-(trifluoromethyl)quinolin-2-one | FLUCARBRIL | 227.18 |
| 16752 | C28H32FNO6 | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxo-ethyl] pyridine-4-carboxylate | DEXAMETHASONE ISONICOTINATE | 497.6 |
| 16753 | C21H26ClNO4 | (6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium chloride | Glaucine hydrochloride | 391.9 |
| 16754 | C21H25NO4 | (6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline | Glaucine | 355.4 |
| 16755 | C21H24BrNO | diethyl-[3-(9-hydroxyfluoren-9-yl)prop-2-ynyl]-methyl-ammonium bromide | 2269-26-3 | 386.3 |
| 16756 | C21H24NO+ | diethyl-[3-(9-hydroxyfluoren-9-yl)prop-2-ynyl]-methyl-ammonium | diethyl-[3-(9-hydroxyfluoren-9-yl)prop-2-ynyl]-methyl-ammonium | 306.4 |
| 16758 | C12H22N4O2 | N-[6-(aziridine-1-carbonylamino)hexyl]aziridine-1-carboxamide | 2271-93-4 | 254.33 |
| 16759 | C20H41NO3 | 2-aminoethanol;octadec-9-enoic acid | Ethanolamine oleate;Phlebocid;Thanomin | 343.5 |
| 16760 | C10H8Cl2N4 | 4,6-dichloro-N-(o-tolyl)-1,3,5-triazin-2-amine | 2272-23-3 | 255.10 |
| 16761 | C10H8Cl2N4 | 4,6-dichloro-N-(p-tolyl)-1,3,5-triazin-2-amine | SCHEMBL6536659 | 255.10 |
| 16762 | C21H15Cl3N6 | N2,N4,N6-tris(2-chlorophenyl)-1,3,5-triazine-2,4,6-triamine | NSC57582 | 457.7 |
| 16763 | C9H5Cl3N4 | 4,6-dichloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine | 4,6-dichloro-N-(4-chlorophenyl)-1,3,5-triazin-2-amine | 275.5 |
| 16764 | C9H4Cl4N4 | 4,6-dichloro-N-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine | 4,6-dichloro-N-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine | 310.0 |
| 16765 | C9H3Cl5N4 | 4,6-dichloro-N-(2,4,5-trichlorophenyl)-1,3,5-triazin-2-amine | 4,6-dichloro-N-(2,4,5-trichlorophenyl)-1,3,5-triazin-2-amine | 344.4 |
| 16766 | C9H6Cl2N4 | 4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine | 4,6-dichloro-N-phenyl-1,3,5-triazin-2-amine | 241.07 |
| 16768 | C7H14N2O2 | N-carbamoyl-2-ethyl-butanamide | Diethylacetylurea | 158.20 |
| 16770 | C12H6Cl4N2S | (4-chlorophenyl)sulfanyl-(2,4,5-trichlorophenyl)diazene | Chlorfensulfide | 352.1 |
| 16771 | C14H29NO2 | 2-(dodecylamino)acetic acid | GLYCINE, N-DODECYL- | 243.39 |
| 16772 | C8H6ClNO3 | 6-chloro-3-(hydroxymethyl)-1,3-benzoxazol-2-one | 2275-07-2 | 199.59 |
| 16774 | C9H20NO3PS2 | 2-diethoxyphosphinothioylsulfanyl-N-isopropyl-acetamide | Prothoate | 285.4 |
| 16775 | C8H18NO4PS2 | 3-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methyl-propanamide | SCHEMBL5934058 | 287.3 |
| 16776 | C8H16N3O2P | ethyl N-[bis(aziridin-1-yl)phosphoryl]ethanimidate | ethyl N-[bis(aziridin-1-yl)phosphoryl]ethanimidate | 217.21 |
| 16779 | C13H6Cl5NO3 | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxy-phenyl)-6-hydroxy-benzamide | Oxyclozanide | 401.4 |
| 16780 | C22H28Cl4N2 | (2-chlorophenyl)methyl-[4-[(2-chlorophenyl)methylammonio]-1-bicyclo[2.2.2]octanyl]ammonium dichloride | N,N'-Bis(2-chlorobenzyl)-1,4-bicyclo(2.2.2)octanediamine dihydrochloride | 462.3 |
| 16781 | C22H26Cl2N2 | N1,N4-bis[(2-chlorophenyl)methyl]bicyclo[2.2.2]octane-1,4-diamine | N1,N4-bis[(2-chlorophenyl)methyl]bicyclo[2.2.2]octane-1,4-diamine | 389.4 |
| 16782 | C2H3NO5 | nitro peroxyacetate | Peroxyacetyl nitrate | 121.05 |
| 16783 | C7H8HgN2O | phenyl(ureido)mercury | Phenylmercuriurea | 336.74 |
| 16785 | C18H36N4O11 | 4-amino-2-[4,6-diamino-3-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-cyclohexoxy]-6-(hydroxymethyl)tetrahydropyran-3,5-diol | 4-amino-2-[4,6-diamino-3-[3-amino-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-cyclohexoxy]-6-(hydroxymethyl)tetrahydropyran-3,5-diol | 484.5 |
| 16786 | C7H6Cl2N2O | 3-amino-2,5-dichloro-benzamide | 3-amino-2,5-dichlorobenzamide | 205.04 |
| 16787 | C13H19NO2 | [3-(1-methylbutyl)phenyl] N-methylcarbamate | 2282-34-0 | 221.29 |
| 16788 | C17H28ClNO2 | [2-(2,6-diethylphenoxy)-1-methyl-2-oxo-ethyl]-diethyl-ammonium chloride | DTXSID90945496 | 313.9 |
| 16789 | C17H27NO2 | (2,6-diethylphenyl) 2-(diethylamino)propanoate | (2,6-diethylphenyl) 2-(diethylamino)propanoate | 277.4 |
| 16791 | C13H19Cl2NO2 | [2-(2-chloro-6-methyl-phenoxy)-2-oxo-ethyl]-diethyl-ammonium chloride | 2283-49-0 | 292.20 |
| 16792 | C13H18ClNO2 | (2-chloro-6-methyl-phenyl) 2-(diethylamino)acetate | (2-chloro-6-methyl-phenyl) 2-(diethylamino)acetate | 255.74 |
| 16794 | C8H4F3NO | 1-isocyanato-2-(trifluoromethyl)benzene | 2-(Trifluoromethyl)phenyl isocyanate | 187.12 |
| 16795 | C16H11F3N2O | 5-phenyl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepin-2-one | 2285-16-7 | 304.27 |
| 16796 | C13H11NO4 | ethyl 3-(1,3-benzodioxol-5-yl)-2-cyano-prop-2-enoate | ethyl 3-(2H-1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate | 245.23 |
| 16797 | C7H15NO3Si | 1-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane | Methylsilatrane | 189.28 |
Related Element Combinations
Explore other compound combinations that include similar elements. Discover more chemistry by browsing related searches.
Looking for a specific combination?
Select any elements from the periodic table and discover all known compounds instantly.
Data Sourced from PubChem
All compound data on CompoundLookup comes from PubChem, the world's largest free chemistry database maintained by the National Institutes of Health (NIH). We've indexed and organized this data to enable element-based searching - a feature not available on any other platform. We're constantly adding more compounds and improving our coverage. Learn more about our mission.